The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((2-amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-5-yl)methyl)benzamido)-4-carbamoylbenzoic acid ID: ALA4454174
PubChem CID: 139207790
Max Phase: Preclinical
Molecular Formula: C22H18N6O5
Molecular Weight: 446.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1ccc(C(=O)O)c(NC(=O)c2ccc(Cc3c[nH]c4nc(N)[nH]c(=O)c34)cc2)c1
Standard InChI: InChI=1S/C22H18N6O5/c23-17(29)12-5-6-14(21(32)33)15(8-12)26-19(30)11-3-1-10(2-4-11)7-13-9-25-18-16(13)20(31)28-22(24)27-18/h1-6,8-9H,7H2,(H2,23,29)(H,26,30)(H,32,33)(H4,24,25,27,28,31)
Standard InChI Key: ZFQOKUXSWWJOFS-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.2399 -5.7616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2399 -6.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9452 -6.9833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9452 -5.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6504 -5.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6549 -6.5753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4301 -6.8225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9048 -6.1616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4229 -5.5060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9452 -4.5317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5328 -6.9884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6711 -4.7274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4695 -4.5531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0162 -5.1609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8139 -4.9871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0629 -4.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5079 -3.6022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7123 -3.7791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8610 -4.0325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4120 -4.6360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1082 -3.2536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9064 -3.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4529 -3.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2504 -3.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4983 -2.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9426 -2.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1472 -2.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5927 -1.7005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8357 -0.9203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7954 -1.8802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8011 -4.1115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5535 -4.8903 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5993 -3.9365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 2 0
2 11 1 0
9 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
28 29 1 0
28 30 2 0
27 28 1 0
24 31 1 0
31 32 1 0
31 33 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.42Molecular Weight (Monoisotopic): 446.1339AlogP: 1.47#Rotatable Bonds: 6Polar Surface Area: 197.05Molecular Species: ACIDHBA: 6HBD: 6#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.23CX Basic pKa: 1.95CX LogP: 1.77CX LogD: -1.43Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.26Np Likeness Score: -0.66
References 1. Czyzyk DJ, Valhondo M, Deiana L, Tirado-Rives J, Jorgensen WL, Anderson KS.. (2019) Structure activity relationship towards design of cryptosporidium specific thymidylate synthase inhibitors., 183 [PMID:31536894 ] [10.1016/j.ejmech.2019.111673 ]