tert-butyl 4-(3-(4-fluorophenyl)-7-hydroxy-2-methylpyrazolo[1,5-a]pyrimidin-5-yl)piperidine-1-carboxylate

ID: ALA4454499

PubChem CID: 121277211

Max Phase: Preclinical

Molecular Formula: C23H27FN4O3

Molecular Weight: 426.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1nn2c(O)cc(C3CCN(C(=O)OC(C)(C)C)CC3)nc2c1-c1ccc(F)cc1

Standard InChI:  InChI=1S/C23H27FN4O3/c1-14-20(16-5-7-17(24)8-6-16)21-25-18(13-19(29)28(21)26-14)15-9-11-27(12-10-15)22(30)31-23(2,3)4/h5-8,13,15,29H,9-12H2,1-4H3

Standard InChI Key:  GGHNXVGKDAGOKZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   19.0430   -5.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0430   -6.4839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7483   -6.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7483   -5.2540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4536   -5.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4581   -6.4803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2333   -6.7276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.7080   -6.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2261   -5.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7487   -7.7055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5252   -6.0621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4743   -4.6325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2727   -4.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5210   -3.6836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9706   -3.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1687   -3.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9241   -4.0337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3352   -5.2624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3348   -4.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6299   -4.0379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9210   -4.4450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9214   -5.2632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6308   -5.6741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2137   -4.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2143   -3.2187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5056   -4.4438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7982   -4.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2178   -2.2995    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.7989   -3.2175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0902   -4.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0862   -3.6237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
  3 10  1  0
  8 11  1  0
  9 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  1  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
  1 18  1  0
 21 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 15 28  1  0
 27 29  1  0
 27 30  1  0
 27 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4454499

    ---

Associated Targets(non-human)

Trpc4 Short transient receptor potential channel 4 (1615 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.49Molecular Weight (Monoisotopic): 426.2067AlogP: 4.66#Rotatable Bonds: 2
Polar Surface Area: 79.96Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.83CX Basic pKa: 1.62CX LogP: 3.88CX LogD: 3.75
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: -1.57

References

1. Sharma S, Hopkins CR..  (2019)  Review of Transient Receptor Potential Canonical (TRPC5) Channel Modulators and Diseases.,  62  (17): [PMID:30943030] [10.1021/acs.jmedchem.8b01954]

Source