5-Methyl-4-(n-octylamino)-1-(4-(trifluoromethyl)benzyl)-pyrimidin-2(1H)-one

ID: ALA4454521

PubChem CID: 147330615

Max Phase: Preclinical

Molecular Formula: C21H28F3N3O

Molecular Weight: 395.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCNc1nc(=O)n(Cc2ccc(C(F)(F)F)cc2)cc1C

Standard InChI:  InChI=1S/C21H28F3N3O/c1-3-4-5-6-7-8-13-25-19-16(2)14-27(20(28)26-19)15-17-9-11-18(12-10-17)21(22,23)24/h9-12,14H,3-8,13,15H2,1-2H3,(H,25,26,28)

Standard InChI Key:  DBOXZEFXEKIZKL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 29  0  0  0  0  0  0  0  0999 V2000
   24.6712  -12.0267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6700  -12.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3781  -13.2635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0918  -12.8499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0890  -12.0231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.3763  -11.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9592  -11.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8043  -13.2615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3779  -14.0848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3738  -10.7965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0896  -14.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0853  -15.3131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7962  -15.7259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5091  -15.3133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5067  -14.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7952  -14.0828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0844  -10.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7975  -10.7923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5081  -10.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2212  -10.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9318  -10.3732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6448  -10.7839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3513  -10.3690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0644  -10.7796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2214  -15.7253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2222  -16.5466    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.9327  -15.3118    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.9277  -16.1333    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  4  8  2  0
  3  9  1  0
  6 10  1  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 14 25  1  0
 25 26  1  0
 25 27  1  0
 25 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4454521

    ---

Associated Targets(non-human)

Tlr4 Toll-like receptor 4 (76 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 395.47Molecular Weight (Monoisotopic): 395.2184AlogP: 5.39#Rotatable Bonds: 10
Polar Surface Area: 46.92Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.36CX LogD: 5.36
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.55Np Likeness Score: -0.96

References

1. Trifonov L, Nudelman V, Zhenin M, Matsree E, Afri M, Schmerling B, Cohen G, Jozwiak K, Weitman M, Korshin E, Senderowitz H, Shainberg A, Hochhauser E, Gruzman A..  (2018)  Structurally Simple, Readily Available Peptidomimetic 1-Benzyl-5-methyl-4-( n-octylamino)pyrimidin-2(1 H)-one Exhibited Efficient Cardioprotection in a Myocardial Ischemia (MI) Mouse Model.,  61  (24): [PMID:30507195] [10.1021/acs.jmedchem.8b01471]

Source