1-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethyl)-5-(chloromethyl)-1H-1,2,3-triazole

ID: ALA4454794

PubChem CID: 155523983

Max Phase: Preclinical

Molecular Formula: C11H19ClN6O3

Molecular Weight: 318.76

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  [N-]=[N+]=NCCOCCOCCOCCn1nncc1CCl

Standard InChI:  InChI=1S/C11H19ClN6O3/c12-9-11-10-15-17-18(11)2-4-20-6-8-21-7-5-19-3-1-14-16-13/h10H,1-9H2

Standard InChI Key:  MIXFSXQKNSZENK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 21  0  0  0  0  0  0  0  0999 V2000
    7.3341   -7.9202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1512   -7.9202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4056   -7.1435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7426   -6.6613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0839   -7.1435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3066   -6.8913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1363   -6.0920    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.7414   -5.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4485   -5.4345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4472   -4.6173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1543   -4.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8627   -4.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5697   -4.2055    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2781   -4.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9852   -4.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6935   -4.6108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4006   -4.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1089   -4.6087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8160   -4.1990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5243   -4.6065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2283   -5.0146    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  5  6  1  0
  6  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  2  0
M  CHG  2  20   1  21  -1
M  END

Alternative Forms

  1. Parent:

    ALA4454794

    ---

Associated Targets(Human)

MGMT Tchem 6-O-methylguanine-DNA methyltransferase (451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 318.76Molecular Weight (Monoisotopic): 318.1207AlogP: 1.38#Rotatable Bonds: 13
Polar Surface Area: 107.16Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.38CX LogP: 0.52CX LogD: 0.40
Aromatic Rings: 1Heavy Atoms: 21QED Weighted: 0.18Np Likeness Score: -0.95

References

1. Gehringer M, Laufer SA..  (2019)  Emerging and Re-Emerging Warheads for Targeted Covalent Inhibitors: Applications in Medicinal Chemistry and Chemical Biology.,  62  (12): [PMID:30565923] [10.1021/acs.jmedchem.8b01153]

Source