(2-(6-Amino-2-(benzylamino)pyrimidin-4-yl)phenyl)methanol

ID: ALA4454924

PubChem CID: 155524066

Max Phase: Preclinical

Molecular Formula: C18H18N4O

Molecular Weight: 306.37

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1cc(-c2ccccc2CO)nc(NCc2ccccc2)n1

Standard InChI:  InChI=1S/C18H18N4O/c19-17-10-16(15-9-5-4-8-14(15)12-23)21-18(22-17)20-11-13-6-2-1-3-7-13/h1-10,23H,11-12H2,(H3,19,20,21,22)

Standard InChI Key:  BXPCOUFFGLPFEM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    3.3540  -12.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3529  -13.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0609  -13.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7706  -13.5680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7678  -12.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0591  -12.3401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4709  -12.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1804  -12.7430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8861  -12.3325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8835  -11.5144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1692  -11.1087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4665  -11.5216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5952  -12.7387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3015  -12.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0106  -12.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0097  -13.5508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7179  -13.9570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4252  -13.5460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4199  -12.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7111  -12.3221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1633  -10.2915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0567  -11.5229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3478  -11.1164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  5  7  1  0
  9 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 11 21  1  0
  6 22  1  0
 22 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4454924

    ---

Associated Targets(Human)

GPR68 Tchem Ovarian cancer G-protein coupled receptor 1 (279 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 306.37Molecular Weight (Monoisotopic): 306.1481AlogP: 2.83#Rotatable Bonds: 5
Polar Surface Area: 84.06Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.50CX LogP: 2.96CX LogD: 2.91
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.67Np Likeness Score: -0.51

References

1. Yu X, Huang XP, Kenakin TP, Slocum ST, Chen X, Martini ML, Liu J, Jin J..  (2019)  Design, Synthesis, and Characterization of Ogerin-Based Positive Allosteric Modulators for G Protein-Coupled Receptor 68 (GPR68).,  62  (16): [PMID:31298539] [10.1021/acs.jmedchem.9b00869]

Source