1-(1-(Mesitylsulfonyl)piperidin-4-yl)azepane

ID: ALA4454956

PubChem CID: 118308375

Max Phase: Preclinical

Molecular Formula: C20H32N2O2S

Molecular Weight: 364.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)c(S(=O)(=O)N2CCC(N3CCCCCC3)CC2)c(C)c1

Standard InChI:  InChI=1S/C20H32N2O2S/c1-16-14-17(2)20(18(3)15-16)25(23,24)22-12-8-19(9-13-22)21-10-6-4-5-7-11-21/h14-15,19H,4-13H2,1-3H3

Standard InChI Key:  ASEDRENIXYQKTG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   28.7090   -1.7582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4230   -2.1668    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   29.4219   -1.3436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.4825   -1.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6612   -1.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2472   -2.1752    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6540   -2.8897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4754   -2.8938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8898   -2.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7067   -2.1850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0127   -2.8791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1928   -2.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7756   -3.5770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1838   -4.2925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0094   -4.2951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4187   -3.5862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7918   -2.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7723   -4.9985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2359   -3.5871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0624   -1.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8606   -1.2718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0620   -2.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5004   -1.7778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8599   -3.1055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4978   -2.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  6  2  1  0
  2 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 12 17  1  0
 14 18  1  0
 16 19  1  0
 10 20  1  0
 20 21  1  0
 10 22  1  0
 21 23  1  0
 22 24  1  0
 23 25  1  0
 24 25  1  0
M  END

Associated Targets(Human)

DLD-1 (17511 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EBP Tchem 3-beta-hydroxysteroid-delta(8),delta(7)-isomerase (102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DHCR7 Tchem 7-dehydrocholesterol reductase (35 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 364.56Molecular Weight (Monoisotopic): 364.2184AlogP: 3.64#Rotatable Bonds: 3
Polar Surface Area: 40.62Molecular Species: BASEHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.20CX LogP: 3.89CX LogD: 2.09
Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.82Np Likeness Score: -1.33

References

1. Wang W, Zhang L, Morlock L, Williams NS, Shay JW, De Brabander JK..  (2019)  Design and Synthesis of TASIN Analogues Specifically Targeting Colorectal Cancer Cell Lines with Mutant Adenomatous Polyposis Coli (APC).,  62  (10): [PMID:31070915] [10.1021/acs.jmedchem.9b00532]
2. Phull MS, Jadav SS, Gundla R, Mainkar PS..  (2021)  A perspective on medicinal chemistry approaches towards adenomatous polyposis coli and Wnt signal based colorectal cancer inhibitors.,  212  [PMID:33445154] [10.1016/j.ejmech.2020.113149]

Source