The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((1H-indol-2-yl)methyl)-6-bromo-2-(pyridin-2-yl)quinoline-4-carboxamide ID: ALA4454974
Cas Number: 713114-51-3
PubChem CID: 2220524
Max Phase: Preclinical
Molecular Formula: C24H17BrN4O
Molecular Weight: 457.33
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1cc2ccccc2[nH]1)c1cc(-c2ccccn2)nc2ccc(Br)cc12
Standard InChI: InChI=1S/C24H17BrN4O/c25-16-8-9-21-18(12-16)19(13-23(29-21)22-7-3-4-10-26-22)24(30)27-14-17-11-15-5-1-2-6-20(15)28-17/h1-13,28H,14H2,(H,27,30)
Standard InChI Key: GBJIMRMDKCTIDZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
13.4245 -6.0752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4233 -6.8948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1314 -7.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1296 -5.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8382 -6.0716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8389 -6.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5475 -7.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2557 -6.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2510 -6.0648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5419 -5.6614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7153 -7.3028 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
15.5492 -8.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8423 -8.5250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2577 -8.5220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8440 -9.3422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1372 -9.7522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3897 -9.4258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0532 -10.5694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2543 -10.7411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8479 -10.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0352 -10.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6279 -10.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0392 -11.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8506 -11.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9562 -5.6519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6637 -6.0596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3684 -5.6474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3639 -4.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6488 -4.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9470 -4.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 1 0
7 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 20 1 0
19 18 1 0
18 16 2 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
9 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.33Molecular Weight (Monoisotopic): 456.0586AlogP: 5.47#Rotatable Bonds: 4Polar Surface Area: 70.67Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.94CX LogP: 4.92CX LogD: 4.92Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.38Np Likeness Score: -1.39
References 1. (2018) Compositions and methods for treating g protein coupled receptor mediated conditions,