N-[4-(Ethyl(isopropyl)amino)phenyl]-3',5-dimethyl-[3,5'-biisoxazole]-4'-carboxamide

ID: ALA4455028

PubChem CID: 155524276

Max Phase: Preclinical

Molecular Formula: C20H24N4O3

Molecular Weight: 368.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(c1ccc(NC(=O)c2c(C)noc2-c2cc(C)on2)cc1)C(C)C

Standard InChI:  InChI=1S/C20H24N4O3/c1-6-24(12(2)3)16-9-7-15(8-10-16)21-20(25)18-14(5)22-27-19(18)17-11-13(4)26-23-17/h7-12H,6H2,1-5H3,(H,21,25)

Standard InChI Key:  IMBNQDUCKAJZPD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   15.7684  -28.1377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7622  -28.9590    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5411  -29.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0323  -28.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5510  -27.8934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8495  -28.5660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2634  -27.8613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2528  -29.2767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0700  -29.2828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4714  -29.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2878  -30.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7025  -29.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2948  -28.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4797  -28.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5197  -29.3018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.9239  -30.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7411  -30.0170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9326  -28.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7497  -28.6016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7858  -29.9989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5110  -30.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8052  -27.1169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5842  -26.8700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5901  -26.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8147  -25.7946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3297  -26.4523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2547  -25.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  4  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  1  0
 18 19  1  0
  3 20  1  0
 16 21  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 22  2  0
  5 22  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4455028

    ---

Associated Targets(non-human)

Gata4 Transcription factor GATA-4 (136 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 368.44Molecular Weight (Monoisotopic): 368.1848AlogP: 4.43#Rotatable Bonds: 6
Polar Surface Area: 84.40Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.54CX Basic pKa: 5.42CX LogP: 3.32CX LogD: 3.31
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.69Np Likeness Score: -1.96

References

1. Jumppanen M, Kinnunen SM, Välimäki MJ, Talman V, Auno S, Bruun T, Boije Af Gennäs G, Xhaard H, Aumüller IB, Ruskoaho H, Yli-Kauhaluoma J..  (2019)  Synthesis, Identification, and Structure-Activity Relationship Analysis of GATA4 and NKX2-5 Protein-Protein Interaction Modulators.,  62  (17): [PMID:31431011] [10.1021/acs.jmedchem.9b01086]

Source