The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-(4-(5-(4-hydroxy-2-methoxyphenyl)-1,3,4-oxadiazol-2-yl)phenyl)-1,3,4-thiadiazol-2-yl)-4-methoxyphenol ID: ALA4455150
PubChem CID: 155524682
Max Phase: Preclinical
Molecular Formula: C24H18N4O5S
Molecular Weight: 474.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(O)c(-c2nnc(-c3ccc(-c4nnc(-c5ccc(O)cc5OC)o4)cc3)s2)c1
Standard InChI: InChI=1S/C24H18N4O5S/c1-31-16-8-10-19(30)18(12-16)24-28-27-23(34-24)14-5-3-13(4-6-14)21-25-26-22(33-21)17-9-7-15(29)11-20(17)32-2/h3-12,29-30H,1-2H3
Standard InChI Key: YONQVVNSRAXTHV-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
17.4031 -9.8351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4020 -10.6547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1100 -11.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8197 -10.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8168 -9.8315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1082 -9.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6939 -11.0627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1058 -8.6091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3969 -8.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5208 -9.4220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2686 -9.7515 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8131 -9.1421 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4018 -8.4359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5454 -8.6090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7283 -7.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5419 -7.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8714 -6.8558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3884 -6.1955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5721 -6.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2463 -7.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7132 -5.4489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5694 -5.2748 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5928 -4.4616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8445 -4.1331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3010 -4.7144 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.6801 -3.3326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2921 -2.7924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1281 -1.9926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3520 -1.7341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7396 -2.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9067 -3.0793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0671 -3.0516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9632 -2.0265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7959 -1.2266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
6 8 1 0
8 9 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 1 0
5 10 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
13 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 1 0
18 21 1 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
27 32 1 0
30 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.50Molecular Weight (Monoisotopic): 474.0998AlogP: 5.02#Rotatable Bonds: 6Polar Surface Area: 123.62Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.26CX Basic pKa: ┄CX LogP: 3.91CX LogD: 3.85Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.44
References 1. Taha M, Imran S, Alomari M, Rahim F, Wadood A, Mosaddik A, Uddin N, Gollapalli M, Alqahtani MA, Bamarouf YA.. (2019) Synthesis of oxadiazole-coupled-thiadiazole derivatives as a potent β-glucuronidase inhibitors and their molecular docking study., 27 (14): [PMID:31196753 ] [10.1016/j.bmc.2019.05.049 ]