2-(5-(4-(5-(4-hydroxy-2-methoxyphenyl)-1,3,4-oxadiazol-2-yl)phenyl)-1,3,4-thiadiazol-2-yl)-4-methoxyphenol

ID: ALA4455150

PubChem CID: 155524682

Max Phase: Preclinical

Molecular Formula: C24H18N4O5S

Molecular Weight: 474.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(O)c(-c2nnc(-c3ccc(-c4nnc(-c5ccc(O)cc5OC)o4)cc3)s2)c1

Standard InChI:  InChI=1S/C24H18N4O5S/c1-31-16-8-10-19(30)18(12-16)24-28-27-23(34-24)14-5-3-13(4-6-14)21-25-26-22(33-21)17-9-7-15(29)11-20(17)32-2/h3-12,29-30H,1-2H3

Standard InChI Key:  YONQVVNSRAXTHV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   17.4031   -9.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4020  -10.6547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1100  -11.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8197  -10.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8168   -9.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1082   -9.4263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6939  -11.0627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1058   -8.6091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3969   -8.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5208   -9.4220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2686   -9.7515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8131   -9.1421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4018   -8.4359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5454   -8.6090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7283   -7.6901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5419   -7.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8714   -6.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3884   -6.1955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5721   -6.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2463   -7.0343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7132   -5.4489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5694   -5.2748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5928   -4.4616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8445   -4.1331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3010   -4.7144    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.6801   -3.3326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2921   -2.7924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1281   -1.9926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3520   -1.7341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7396   -2.2816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9067   -3.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0671   -3.0516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9632   -2.0265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7959   -1.2266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  6  8  1  0
  8  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
  5 10  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
 18 21  1  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 27 32  1  0
 30 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4455150

    ---

Associated Targets(Human)

GUSB Tchem Beta-glucuronidase (537 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.50Molecular Weight (Monoisotopic): 474.0998AlogP: 5.02#Rotatable Bonds: 6
Polar Surface Area: 123.62Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.26CX Basic pKa: CX LogP: 3.91CX LogD: 3.85
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.44

References

1. Taha M, Imran S, Alomari M, Rahim F, Wadood A, Mosaddik A, Uddin N, Gollapalli M, Alqahtani MA, Bamarouf YA..  (2019)  Synthesis of oxadiazole-coupled-thiadiazole derivatives as a potent β-glucuronidase inhibitors and their molecular docking study.,  27  (14): [PMID:31196753] [10.1016/j.bmc.2019.05.049]

Source