The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(2-((2-methoxy-4-(4-morpholinopiperidin-1-yl)phenyl)amino)pyridin-4-yl)-N-(4-(trifluoromethoxy)benzyl)piperidine-3-carboxamide ID: ALA4455502
PubChem CID: 155524577
Max Phase: Preclinical
Molecular Formula: C35H43F3N6O4
Molecular Weight: 668.76
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCC(N3CCOCC3)CC2)ccc1Nc1cc(N2CCC[C@H](C(=O)NCc3ccc(OC(F)(F)F)cc3)C2)ccn1
Standard InChI: InChI=1S/C35H43F3N6O4/c1-46-32-21-28(42-15-11-27(12-16-42)43-17-19-47-20-18-43)6-9-31(32)41-33-22-29(10-13-39-33)44-14-2-3-26(24-44)34(45)40-23-25-4-7-30(8-5-25)48-35(36,37)38/h4-10,13,21-22,26-27H,2-3,11-12,14-20,23-24H2,1H3,(H,39,41)(H,40,45)/t26-/m0/s1
Standard InChI Key: KZDFKXHSGQQXNG-SANMLTNESA-N
Molfile:
RDKit 2D
48 53 0 0 0 0 0 0 0 0999 V2000
27.9331 -2.9592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9331 -3.7805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6425 -4.1891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3519 -3.7805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3519 -2.9592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6425 -2.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6421 -5.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9286 -5.4176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9282 -6.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6406 -6.6517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3548 -6.2346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3517 -5.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0649 -2.5527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7756 -2.9634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0673 -1.7314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4886 -2.5569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1992 -2.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1955 -3.7899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9012 -4.2046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6152 -3.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6149 -2.9683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9046 -2.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2162 -6.6505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5079 -6.2429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5084 -5.4272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8009 -5.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0928 -5.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0965 -6.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8045 -6.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3226 -4.2029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3221 -5.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0295 -5.4292 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.6141 -5.4283 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.3179 -5.8359 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.3840 -5.0226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3841 -4.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6794 -3.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9704 -4.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9706 -5.0272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6799 -5.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2631 -3.7996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2624 -2.9798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5592 -2.5705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8486 -2.9749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8457 -3.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5534 -4.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8091 -7.4717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1036 -7.8842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
5 13 1 6
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
9 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
20 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
27 35 1 0
35 36 1 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
38 41 1 0
41 42 1 0
41 46 1 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
29 47 1 0
47 48 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 668.76Molecular Weight (Monoisotopic): 668.3298AlogP: 5.57#Rotatable Bonds: 10Polar Surface Area: 91.43Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.35CX LogP: 5.46CX LogD: 3.60Aromatic Rings: 3Heavy Atoms: 48QED Weighted: 0.29Np Likeness Score: -1.50
References 1. Liu S, Jiang Y, Yan R, Li Z, Wan S, Zhang T, Wu X, Hou J, Zhu Z, Tian Y, Zhang J.. (2019) Design, synthesis and biological evaluations of 2-amino-4-(1-piperidine) pyridine derivatives as novel anti crizotinib-resistant ALK/ROS1 dual inhibitors., 179 [PMID:31260890 ] [10.1016/j.ejmech.2019.06.043 ]