2-[(3S,4R)-1-[(2,6-Dichlorophenyl)methyl]-3-({1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-yl}carbamoyl)-4-methylpyrrolidin-3-yl]acetic acid

ID: ALA4456446

PubChem CID: 71293610

Max Phase: Preclinical

Molecular Formula: C27H37Cl2F2N3O3

Molecular Weight: 560.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H]1CN(Cc2c(Cl)cccc2Cl)C[C@@]1(CC(=O)O)C(=O)NC1CCN(CC2CCC(F)(F)CC2)CC1

Standard InChI:  InChI=1S/C27H37Cl2F2N3O3/c1-18-14-34(16-21-22(28)3-2-4-23(21)29)17-26(18,13-24(35)36)25(37)32-20-7-11-33(12-8-20)15-19-5-9-27(30,31)10-6-19/h2-4,18-20H,5-17H2,1H3,(H,32,37)(H,35,36)/t18-,26+/m0/s1

Standard InChI Key:  NDYGUVWYIVLZCY-HFJWLAOPSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   26.6375  -11.9358    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.6667  -11.0984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4959  -11.2776    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.8501  -11.2149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3376  -10.5441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6460   -9.7858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4626   -9.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9710  -10.3108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1335   -9.1149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2877   -9.2357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.7794   -8.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9626   -8.7106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6543   -9.4689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1668  -10.1398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9835  -10.0232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8084   -9.5897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3001   -8.9480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6044   -8.1605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4834   -9.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7418   -9.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1042  -10.3688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4043   -9.8438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6501   -9.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1418   -8.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1000  -11.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3875  -11.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4207  -12.4605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7083  -12.8896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9666  -12.4896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9375  -11.6604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6458  -11.2021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6458  -10.3688    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   20.1333  -12.8647    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   20.2220   -8.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7634   -7.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5019   -6.8982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5641   -7.8455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  4  2  1  0
  5  4  1  0
  6  5  1  0
  6  7  1  0
  8  7  1  0
  2  8  1  0
  9  6  1  0
 10  9  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 10 15  1  0
 16 13  1  0
 17 16  1  0
 17 18  2  0
 19 17  1  6
 20 19  1  0
 21 20  1  0
 21 22  1  0
 23 22  1  0
 23 24  1  6
 19 23  1  0
 21 25  1  0
 25 26  1  0
 26 27  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 31 32  1  0
 26 31  1  0
 27 33  1  0
 19 34  1  0
 34 35  1  0
 35 36  2  0
 35 37  1  0
M  END

Associated Targets(Human)

CX3CR1 Tchem C-X3-C chemokine receptor 1 (1686 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 560.51Molecular Weight (Monoisotopic): 559.2180AlogP: 5.31#Rotatable Bonds: 8
Polar Surface Area: 72.88Molecular Species: ZWITTERIONHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.85CX Basic pKa: 9.15CX LogP: 1.04CX LogD: 0.34
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.45Np Likeness Score: -0.59

References

1.  (2014)  Pyrrolidine-3-ylacetic acid derivative, 

Source