The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((S)-1-(((2S,3R)-1-((2-(((4-(2-(acetamidomethyl)phenyl)-5-methyl-4H-1,2,4-triazol-3-yl)methyl)amino)-2-oxoethyl)amino)-3-hydroxy-1-oxobutan-2-yl)amino)-3-hydroxy-1-oxopropan-2-yl)-2-amino-6-(dimethylamino)hexanamide ID: ALA4456448
PubChem CID: 131953521
Max Phase: Preclinical
Molecular Formula: C30H48N10O7
Molecular Weight: 660.78
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)NCc1ccccc1-n1c(C)nnc1CNC(=O)CNC(=O)[C@@H](NC(=O)[C@H](CO)NC(=O)[C@@H](N)CCCCN(C)C)[C@@H](C)O
Standard InChI: InChI=1S/C30H48N10O7/c1-18(42)27(36-29(46)23(17-41)35-28(45)22(31)11-8-9-13-39(4)5)30(47)34-16-26(44)33-15-25-38-37-19(2)40(25)24-12-7-6-10-21(24)14-32-20(3)43/h6-7,10,12,18,22-23,27,41-42H,8-9,11,13-17,31H2,1-5H3,(H,32,43)(H,33,44)(H,34,47)(H,35,45)(H,36,46)/t18-,22+,23+,27+/m1/s1
Standard InChI Key: RNSFKEYYXWNCOX-FFFNHMGKSA-N
Molfile:
RDKit 2D
47 48 0 0 0 0 0 0 0 0999 V2000
14.8069 -10.2244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9897 -10.2288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7414 -11.0074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4052 -11.4842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0636 -11.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5400 -11.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2477 -11.0114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8322 -11.0114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5400 -12.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8322 -12.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8322 -13.4630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1245 -13.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1245 -14.6888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4168 -15.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8322 -15.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9554 -11.4200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2477 -10.1943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6631 -11.0114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3708 -11.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6631 -10.1943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3708 -9.7857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0785 -11.0114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3708 -12.2372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7862 -11.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4939 -11.0114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7862 -12.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0785 -12.6458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4939 -12.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2016 -11.4200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4939 -10.1943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9093 -11.0114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6170 -11.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3247 -11.0114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6170 -12.2372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0325 -11.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8421 -11.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4097 -12.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7031 -12.7096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7072 -13.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4177 -13.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1255 -13.5146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1178 -12.6996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8213 -12.2837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5332 -12.6849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2366 -12.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9485 -12.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2282 -11.4519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 1 2 0
6 7 1 0
6 8 1 0
6 9 1 6
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 1 0
7 16 1 0
7 17 2 0
16 18 1 0
18 19 1 0
18 20 1 1
20 21 1 0
19 22 1 0
19 23 2 0
22 24 1 0
24 25 1 6
24 26 1 0
26 27 1 1
26 28 1 0
25 29 1 0
25 30 2 0
29 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
35 3 1 0
5 36 1 0
4 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
45 47 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 660.78Molecular Weight (Monoisotopic): 660.3707AlogP: -2.65#Rotatable Bonds: 19Polar Surface Area: 245.93Molecular Species: BASEHBA: 12HBD: 8#RO5 Violations: 3HBA (Lipinski): 17HBD (Lipinski): 9#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.51CX Basic pKa: 12.96CX LogP: -4.80CX LogD: -7.83Aromatic Rings: 2Heavy Atoms: 47QED Weighted: 0.07Np Likeness Score: -0.69
References 1. Mader P, Mendoza-Sanchez R, Iqbal A, Dong A, Dobrovetsky E, Corless VB, Liew SK, Houliston SR, De Freitas RF, Smil D, Sena CCD, Kennedy S, Diaz DB, Wu H, Dombrovski L, Allali-Hassani A, Min J, Schapira M, Vedadi M, Brown PJ, Santhakumar V, Yudin AK, Arrowsmith CH.. (2019) Identification and characterization of the first fragment hits for SETDB1 Tudor domain., 27 (17): [PMID:31327677 ] [10.1016/j.bmc.2019.07.020 ]