The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-1-((4-(2-((2-Aminoethyl)disulfanyl)ethoxy)-3-methoxyphenethyl)amino)-3-(4-(2-methoxyethyl)phenoxy)propan-2-ol ID: ALA4456505
PubChem CID: 155524756
Max Phase: Preclinical
Molecular Formula: C25H38N2O5S2
Molecular Weight: 510.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCc1ccc(OC[C@H](O)CNCCc2ccc(OCCSSCCN)c(OC)c2)cc1
Standard InChI: InChI=1S/C25H38N2O5S2/c1-29-13-10-20-3-6-23(7-4-20)32-19-22(28)18-27-12-9-21-5-8-24(25(17-21)30-2)31-14-16-34-33-15-11-26/h3-8,17,22,27-28H,9-16,18-19,26H2,1-2H3/t22-/m1/s1
Standard InChI Key: DMFJWPHVIMGYIO-JOCHJYFZSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
26.3730 -26.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0848 -25.8241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7967 -26.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5044 -25.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2162 -26.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5044 -25.0028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9280 -25.8241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.6399 -26.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3517 -25.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9498 -27.0554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6666 -27.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3751 -27.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9503 -26.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6595 -25.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0635 -26.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0617 -27.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7727 -27.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4814 -27.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4787 -26.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7713 -25.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1891 -25.8183 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1938 -27.4667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1862 -24.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9050 -27.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6174 -27.4648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3287 -27.0553 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.0411 -27.4629 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.7524 -27.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4648 -27.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1719 -27.0515 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.2385 -27.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5261 -27.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8149 -27.4668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1125 -27.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
4 6 1 6
5 7 1 0
7 8 1 0
8 9 1 0
1 14 2 0
13 10 2 0
10 11 1 0
11 12 2 0
12 1 1 0
13 14 1 0
9 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
19 21 1 0
18 22 1 0
21 23 1 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
10 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.72Molecular Weight (Monoisotopic): 510.2222AlogP: 3.18#Rotatable Bonds: 19Polar Surface Area: 95.20Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.79CX LogP: 2.56CX LogD: -1.49Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.19Np Likeness Score: -0.27
References 1. Schwalbe T, Huebner H, Gmeiner P.. (2019) Development of covalent antagonists for β1- and β2-adrenergic receptors., 27 (13): [PMID:31151791 ] [10.1016/j.bmc.2019.05.034 ]