The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(4-amino-7-isopropylpyrrolo[1,2-f][1,2,4]triazine-5-carbonyl)phenyl)-3-(2,4-dichlorophenyl)urea ID: ALA4457005
PubChem CID: 16112865
Max Phase: Preclinical
Molecular Formula: C23H20Cl2N6O2
Molecular Weight: 483.36
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1cc(C(=O)c2cccc(NC(=O)Nc3ccc(Cl)cc3Cl)c2)c2c(N)ncnn12
Standard InChI: InChI=1S/C23H20Cl2N6O2/c1-12(2)19-10-16(20-22(26)27-11-28-31(19)20)21(32)13-4-3-5-15(8-13)29-23(33)30-18-7-6-14(24)9-17(18)25/h3-12H,1-2H3,(H2,26,27,28)(H2,29,30,33)
Standard InChI Key: JSLIJLUSLPYLEM-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
19.2907 -28.2674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2896 -29.0947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0044 -29.5076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0026 -27.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7180 -28.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7229 -29.0902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5103 -29.3409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9923 -28.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5026 -28.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0001 -27.0295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7698 -30.1242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2214 -30.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5779 -30.2910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7528 -27.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5588 -27.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1973 -26.6078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1110 -27.6515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9164 -27.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1673 -26.6889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6068 -26.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8037 -26.2566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4716 -28.0858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2777 -27.9100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8331 -28.5202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5285 -27.1240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6391 -28.3443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1911 -28.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9966 -28.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2480 -27.9943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6878 -27.3828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8845 -27.5613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9385 -29.7416 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
29.0538 -27.8173 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 6 1 0
5 4 1 0
4 1 2 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
4 10 1 0
7 11 1 0
11 12 1 0
11 13 1 0
9 14 1 0
14 15 1 0
14 16 2 0
15 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 15 1 0
18 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
27 32 1 0
29 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.36Molecular Weight (Monoisotopic): 482.1025AlogP: 5.62#Rotatable Bonds: 5Polar Surface Area: 114.41Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.82CX Basic pKa: 0.46CX LogP: 5.46CX LogD: 5.46Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -1.57