The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-((2-((7-Nitrobenzo[c][1,2,5]oxadiazol-4-yl)amino)benzamido)methyl)phenyl)boronic acid ID: ALA4457513
PubChem CID: 145124306
Max Phase: Preclinical
Molecular Formula: C20H16BN5O6
Molecular Weight: 433.19
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1ccc(B(O)O)cc1)c1ccccc1Nc1ccc([N+](=O)[O-])c2nonc12
Standard InChI: InChI=1S/C20H16BN5O6/c27-20(22-11-12-5-7-13(8-6-12)21(28)29)14-3-1-2-4-15(14)23-16-9-10-17(26(30)31)19-18(16)24-32-25-19/h1-10,23,28-29H,11H2,(H,22,27)
Standard InChI Key: DFVATHMAHQYGPC-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
30.0815 -17.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1012 -16.8037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1003 -15.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0798 -15.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1010 -15.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1019 -16.8022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0789 -13.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0985 -13.3331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0977 -12.1899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0765 -11.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0756 -10.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0952 -9.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0749 -10.4364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0758 -11.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0970 -12.1914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0959 -9.8625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0950 -8.7193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0738 -8.1484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0729 -6.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0933 -6.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0736 -6.9628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1758 -6.5945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8706 -7.5331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.1772 -8.4727 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0745 -8.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0924 -5.2487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0719 -4.6763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0712 -4.6778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0772 -11.6175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0824 -18.5178 0.0000 B 0 0 0 0 0 0 0 0 0 0 0 0
31.1036 -19.1295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1029 -19.1311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
4 7 1 0
7 8 1 0
9 8 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
11 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
21 20 1 0
22 21 2 0
23 22 1 0
23 24 1 0
25 24 2 0
21 25 1 0
25 17 1 0
20 26 1 0
26 27 2 0
26 28 1 0
9 29 2 0
1 30 1 0
30 31 1 0
30 32 1 0
M CHG 2 26 1 28 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.19Molecular Weight (Monoisotopic): 433.1194AlogP: ┄#Rotatable Bonds: ┄Polar Surface Area: ┄Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: ┄HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: ┄CX LogD: ┄Aromatic Rings: ┄Heavy Atoms: ┄QED Weighted: ┄Np Likeness Score: ┄
References 1. (2016) C-myc ligands capable of dimerizing in an aqueous solution, and methods of using same,