The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6,7-Dimethoxy-2-((4'-(3-((4-(phenylsulfinyl)-1,2,5-oxadiazol-3-yl)oxy)ethoxy)biphen-4-yl)methyl)-1,2,3,4-tetrahydroisoquinoline ID: ALA4458009
PubChem CID: 155525927
Max Phase: Preclinical
Molecular Formula: C34H33N3O6S
Molecular Weight: 611.72
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(Cc1ccc(-c3ccc(OCCOc4nonc4[S+]([O-])c4ccccc4)cc3)cc1)CC2
Standard InChI: InChI=1S/C34H33N3O6S/c1-39-31-20-27-16-17-37(23-28(27)21-32(31)40-2)22-24-8-10-25(11-9-24)26-12-14-29(15-13-26)41-18-19-42-33-34(36-43-35-33)44(38)30-6-4-3-5-7-30/h3-15,20-21H,16-19,22-23H2,1-2H3
Standard InChI Key: ZNYYHYCVVJWSNX-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
23.3174 -3.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3163 -4.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0243 -4.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0225 -3.0456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7312 -3.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7345 -4.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4469 -4.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1605 -4.2702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1571 -3.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4401 -3.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8693 -4.6769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5759 -4.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2808 -4.6761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9869 -4.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9851 -3.4482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2713 -3.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5682 -3.4539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6877 -3.0363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3973 -3.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1029 -3.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1000 -2.2149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3857 -1.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6831 -2.2224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8055 -1.8025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5154 -2.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6082 -4.6820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9009 -4.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6096 -3.0460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9020 -3.4548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2209 -1.7949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9308 -2.1996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6363 -1.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3822 -2.1193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.9257 -1.5091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.5133 -0.8035 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7150 -0.9779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1040 -0.4351 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.2686 0.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3285 -0.6929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0442 0.6151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2089 1.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6013 1.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8263 1.7002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6653 0.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
8 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
21 24 1 0
24 25 1 0
2 26 1 0
26 27 1 0
1 28 1 0
28 29 1 0
25 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 1 0
35 36 2 0
36 32 1 0
36 37 1 0
37 38 1 0
37 39 1 0
38 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 38 1 0
M CHG 2 37 1 39 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 611.72Molecular Weight (Monoisotopic): 611.2090AlogP: 5.94#Rotatable Bonds: 12Polar Surface Area: 102.14Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.70CX LogP: 6.09CX LogD: 5.61Aromatic Rings: 5Heavy Atoms: 44QED Weighted: 0.13Np Likeness Score: -0.75
References 1. Guglielmo S, Lazzarato L, Contino M, Perrone MG, Chegaev K, Carrieri A, Fruttero R, Colabufo NA, Gasco A.. (2016) Structure-Activity Relationship Studies on Tetrahydroisoquinoline Derivatives: [4'-(6,7-Dimethoxy-3,4-dihydro-1H-isoquinolin-2-ylmethyl)biphenyl-4-ol] (MC70) Conjugated through Flexible Alkyl Chains with Furazan Moieties Gives Rise to Potent and Selective Ligands of P-glycoprotein., 59 (14): [PMID:27336199 ] [10.1021/acs.jmedchem.6b00252 ]