(1S,2R,4aS,5R,8aS)-1-formamido-1,4a-dimethyl-6-methylene-5-((E)-2-(2-oxo-2,5-dihydrofuran-3-yl)ethenyl)decahydronaphthalen-2-yl nicotinate

ID: ALA4458194

PubChem CID: 155527164

Max Phase: Preclinical

Molecular Formula: C26H30N2O5

Molecular Weight: 450.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1CC[C@H]2[C@@](C)(CC[C@@H](OC(=O)c3cccnc3)[C@@]2(C)NC=O)[C@@H]1/C=C/C1=CCOC1=O

Standard InChI:  InChI=1S/C26H30N2O5/c1-17-6-9-21-25(2,20(17)8-7-18-11-14-32-23(18)30)12-10-22(26(21,3)28-16-29)33-24(31)19-5-4-13-27-15-19/h4-5,7-8,11,13,15-16,20-22H,1,6,9-10,12,14H2,2-3H3,(H,28,29)/b8-7+/t20-,21+,22-,25+,26+/m1/s1

Standard InChI Key:  BFVKKFFBVHUAJT-AAQQYLJGSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   36.1545  -16.4594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7501  -15.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3411  -16.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1611  -15.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8664  -15.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8664  -14.5320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1611  -14.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6663  -16.1375    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   36.4517  -13.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1609  -13.3021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8686  -12.8933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8684  -12.0761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5259  -11.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2732  -10.8157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.4559  -10.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2037  -11.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3038  -11.8431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.5753  -14.1255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4558  -15.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4602  -14.5347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7609  -14.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0527  -14.5272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0484  -15.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7437  -17.1658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9265  -17.1632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3381  -15.7458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6330  -15.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9227  -15.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6382  -14.5155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2213  -15.3229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5115  -15.7264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5059  -16.5444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2160  -16.9574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9229  -16.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 20  7  1  0
 19  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
 19  8  1  1
 20  9  1  6
  7 10  1  6
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  2  0
 13 17  2  0
  6 18  2  0
 19 20  1  0
 19  2  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23  2  1  0
  2  1  1  0
  2  3  1  1
  1 24  1  0
 24 25  2  0
 23 26  1  6
 26 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4458194

    ---

Associated Targets(Human)

HK2 Tchem Hexokinase type II (81 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

RAW264.7 (28094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.54Molecular Weight (Monoisotopic): 450.2155AlogP: 3.53#Rotatable Bonds: 6
Polar Surface Area: 94.59Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.57CX Basic pKa: 3.24CX LogP: 3.14CX LogD: 3.14
Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: 2.40

References

1. Wang W, Wu Y, Yang K, Wu C, Tang R, Li H, Chen L..  (2019)  Synthesis of novel andrographolide beckmann rearrangement derivatives and evaluation of their HK2-related anti-inflammatory activities.,  173  [PMID:31009914] [10.1016/j.ejmech.2019.04.022]

Source