The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-(6-acetyl-3-(isopropylamino)-5,6,7,8-tetrahydropyrido[3,4-b]pyrazin-2-yl)piperazin-1-yl)methyl)-3-fluorobenzonitrile trifluoroacteic acid ID: ALA4458257
PubChem CID: 155526607
Max Phase: Preclinical
Molecular Formula: C26H31F4N7O3
Molecular Weight: 451.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CCc2nc(N3CCN(Cc4ccc(C#N)cc4F)CC3)c(NC(C)C)nc2C1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C24H30FN7O.C2HF3O2/c1-16(2)27-23-24(29-21-6-7-32(17(3)33)15-22(21)28-23)31-10-8-30(9-11-31)14-19-5-4-18(13-26)12-20(19)25;3-2(4,5)1(6)7/h4-5,12,16H,6-11,14-15H2,1-3H3,(H,27,28);(H,6,7)
Standard InChI Key: VXBVFEYMWOSBLH-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 42 0 0 0 0 0 0 0 0999 V2000
32.2611 -6.1194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9688 -5.7108 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.5534 -5.7108 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.2570 -5.3022 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.2632 -6.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5565 -7.3470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9719 -7.3434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6760 -5.2952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4137 -3.6293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2562 -5.2944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4178 -2.8034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9925 -2.7947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5476 -4.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8309 -5.2856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4015 -5.2770 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8432 -3.6380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1264 -4.0424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9885 -3.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2684 -3.6468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5517 -4.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2798 -2.3775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9729 -4.8857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.9770 -4.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7093 -2.3861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6970 -4.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1182 -4.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3858 -4.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6723 -6.1124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5697 -2.7817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8653 -2.3652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1556 -2.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1502 -3.5869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8603 -3.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5671 -3.5937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8722 -1.5481 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.4405 -3.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3971 -6.0941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6872 -6.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1025 -6.5066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7309 -4.3973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
1 5 1 0
5 6 2 0
5 7 1 0
20 19 1 0
9 25 1 0
17 26 2 0
25 18 1 0
14 26 1 0
18 12 1 0
17 9 1 0
26 15 1 0
9 11 1 0
13 10 1 0
12 21 1 0
13 14 2 0
10 22 1 0
16 17 1 0
12 24 1 0
13 20 1 0
19 23 1 0
20 16 2 0
23 22 1 0
24 11 1 0
22 8 1 0
8 27 1 0
8 28 2 0
21 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
30 35 1 0
32 36 1 0
15 37 1 0
37 38 1 0
37 39 1 0
36 40 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.55Molecular Weight (Monoisotopic): 451.2496AlogP: 2.53#Rotatable Bonds: 5Polar Surface Area: 88.39Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.11CX LogP: 1.97CX LogD: 1.95Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.75Np Likeness Score: -1.86
References 1. (2016) Tetrahydropyridopyrazines modulators of gpr6,