[4-isothiocyanatobut-1-enyl]-oxidophenylsulfonium

ID: ALA4458289

PubChem CID: 134216299

Max Phase: Preclinical

Molecular Formula: C11H11NOS2

Molecular Weight: 237.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  [O-][S+](/C=C/CCN=C=S)c1ccccc1

Standard InChI:  InChI=1S/C11H11NOS2/c13-15(9-5-4-8-12-10-14)11-6-2-1-3-7-11/h1-3,5-7,9H,4,8H2/b9-5+

Standard InChI Key:  KQIIWWSBYPTLNK-WEVVVXLNSA-N

Molfile:  

 
     RDKit          2D

 15 15  0  0  0  0  0  0  0  0999 V2000
    3.9817  -24.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9806  -25.7887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6953  -26.2015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4118  -25.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4089  -24.9577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6935  -24.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1218  -24.5425    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.8378  -24.9524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5506  -24.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2667  -24.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9795  -24.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6955  -24.9416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4084  -24.5264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1186  -23.7175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1204  -24.1072    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  5  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
  7 14  1  0
 13 15  2  0
M  CHG  2   7   1  14  -1
M  END

Alternative Forms

  1. Parent:

    ALA4458289

    ---

Associated Targets(Human)

XPO1 Tclin Exportin-1 (375 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 237.35Molecular Weight (Monoisotopic): 237.0282AlogP: 2.80#Rotatable Bonds: 5
Polar Surface Area: 35.42Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.64CX LogP: 2.42CX LogD: 2.42
Aromatic Rings: 1Heavy Atoms: 15QED Weighted: 0.34Np Likeness Score: 0.63

References

1. Tian X, Gao J, Liu M, Lei Y, Wang F, Chen J, Chu P, Gao J, Long F, Liang M, Long X, Chu H, Liu C, Li X, Sun Q, Li G, Yang Y..  (2020)  Small-Molecule Antagonist Targeting Exportin-1 via Rational Structure-Based Discovery.,  63  (8): [PMID:32223194] [10.1021/acs.jmedchem.9b01663]

Source