((1aR,7aS,10aS,10bS,E)-1a-methyl-8-methylene-9-oxo-1a,2,3,6,7,7a,8,9,10a,10b-decahydrooxireno[2',3':9,10]cyclodeca[1,2-b]furan-5-yl)methyl 2-(3-(3,4-difluorobenzyl)-5-fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetate

ID: ALA4458414

PubChem CID: 155526803

Max Phase: Preclinical

Molecular Formula: C28H27F3N2O7

Molecular Weight: 560.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)Cn1cc(F)c(=O)n(Cc3ccc(F)c(F)c3)c1=O)=C\CC[C@@]1(C)O[C@@H]21

Standard InChI:  InChI=1S/C28H27F3N2O7/c1-15-18-7-5-16(4-3-9-28(2)24(40-28)23(18)39-26(15)36)14-38-22(34)13-32-12-21(31)25(35)33(27(32)37)11-17-6-8-19(29)20(30)10-17/h4,6,8,10,12,18,23-24H,1,3,5,7,9,11,13-14H2,2H3/b16-4+/t18-,23-,24-,28+/m0/s1

Standard InChI Key:  OYTQLKBJUZJCOX-MYVVILIASA-N

Molfile:  

 
     RDKit          2D

 43 47  0  0  0  0  0  0  0  0999 V2000
   17.1160   -8.2080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5674   -7.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7504   -7.4755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3758   -9.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0036   -8.9969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6800   -9.0905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8776   -8.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6916   -8.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8870   -7.4431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1966   -7.0082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1704   -6.1819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3743   -6.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5079   -5.6882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7098   -5.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8948   -5.8037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5845   -6.2420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3090   -5.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3437   -5.0474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0714   -7.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4962   -6.7091    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.7970   -9.1923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5021   -8.1660    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.4334  -10.3397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1949   -8.6671    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.9987   -6.3022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7231   -5.9241    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4103   -6.3650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1325   -5.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1714   -5.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4820   -4.7332    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.7536   -5.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0637   -4.6713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8973   -4.7983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8205   -6.4312    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.5195   -3.9169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2452   -3.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9325   -3.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6577   -3.6103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6957   -2.7931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0025   -2.3524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2801   -2.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3456   -4.0513    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   25.4209   -2.4165    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  6  4  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  2  7  1  0
 10 11  1  0
  3 12  1  0
 11 13  2  0
 12 14  1  0
 13 14  1  0
 11 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
  3 19  1  1
  2 20  1  1
  5 21  2  0
  8 22  1  6
  4 23  2  0
  7 24  1  1
 17 25  1  0
 25 26  1  0
 26 27  1  0
 26 31  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 29 33  2  0
 28 34  1  0
 30 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 38 42  1  0
 39 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4458414

    ---

Associated Targets(Human)

Bel7402/5-FU (373 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Bel-7402 (4577 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 560.53Molecular Weight (Monoisotopic): 560.1770AlogP: 2.77#Rotatable Bonds: 6
Polar Surface Area: 109.13Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.73CX LogD: 3.73
Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.23Np Likeness Score: 0.69

References

1. Ding Y, Li S, Ge W, Liu Z, Zhang X, Wang M, Chen T, Chen Y, Zhang Q..  (2019)  Design and synthesis of parthenolide and 5-fluorouracil conjugates as potential anticancer agents against drug resistant hepatocellular carcinoma.,  183  [PMID:31553932] [10.1016/j.ejmech.2019.111706]

Source