The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(Hydroxycarbamoyl)benzyl)-3,5-dimethyl-N-(3-oxo-3-(p-tolylamino)propyl)benzamide ID: ALA4458544
PubChem CID: 155526623
Max Phase: Preclinical
Molecular Formula: C27H29N3O4
Molecular Weight: 459.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(NC(=O)CCN(Cc2ccc(C(=O)NO)cc2)C(=O)c2cc(C)cc(C)c2)cc1
Standard InChI: InChI=1S/C27H29N3O4/c1-18-4-10-24(11-5-18)28-25(31)12-13-30(27(33)23-15-19(2)14-20(3)16-23)17-21-6-8-22(9-7-21)26(32)29-34/h4-11,14-16,34H,12-13,17H2,1-3H3,(H,28,31)(H,29,32)
Standard InChI Key: BNKSQBVDOVWOLC-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
33.3837 -23.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3826 -24.0517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0906 -24.4606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8003 -24.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7975 -23.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0888 -22.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5086 -24.4587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5099 -25.2759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2157 -24.0490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.9241 -24.4565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6759 -22.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9683 -23.2325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2605 -22.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2603 -22.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5525 -21.5984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5523 -20.7812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8449 -22.0072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9685 -24.0497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2609 -24.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6763 -24.4581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2599 -20.3725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5546 -24.0462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8475 -24.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8472 -25.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5600 -25.6806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2642 -25.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1399 -24.0455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5631 -26.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9667 -20.7838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6739 -20.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6741 -19.5577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9613 -19.1494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2571 -19.5599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3812 -19.1480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
1 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
12 18 1 0
18 19 1 0
18 20 2 0
16 21 1 0
19 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 19 1 0
23 27 1 0
25 28 1 0
21 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 21 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 459.55Molecular Weight (Monoisotopic): 459.2158AlogP: 4.40#Rotatable Bonds: 8Polar Surface Area: 98.74Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.05CX Basic pKa: ┄CX LogP: 4.53CX LogD: 4.52Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -1.47
References 1. Reßing N, Marquardt V, Gertzen CGW, Schöler A, Schramm A, Kurz T, Gohlke H, Aigner A, Remke M, Hansen FK.. (2019) Design, synthesis and biological evaluation of β-peptoid-capped HDAC inhibitors with anti-neuroblastoma and anti-glioblastoma activity., 10 (7): [PMID:31391882 ] [10.1039/C8MD00454D ]