The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(bis(4-chlorophenyl)methyl)-3-(2-(2-chloro-4-(chloromethyl)phenyl)-2-(2,4-dichlorobenzyloxy)ethyl)-1H-imidazol-3-ium ID: ALA4458563
PubChem CID: 57519828
Max Phase: Preclinical
Molecular Formula: C32H25Cl6N2O+
Molecular Weight: 666.28
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: ClCc1ccc(C(C[n+]2ccn(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)c2)OCc2ccc(Cl)cc2Cl)c(Cl)c1
Standard InChI: InChI=1S/C32H25Cl6N2O/c33-17-21-1-12-28(30(38)15-21)31(41-19-24-6-11-27(36)16-29(24)37)18-39-13-14-40(20-39)32(22-2-7-25(34)8-3-22)23-4-9-26(35)10-5-23/h1-16,20,31-32H,17-19H2/q+1
Standard InChI Key: QFAZWBSIQZNXKF-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
10.7390 -8.4278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5562 -8.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8106 -7.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1476 -7.1690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4889 -7.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2578 -9.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4452 -9.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5892 -9.8353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1063 -10.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4370 -11.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2505 -11.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7320 -10.6636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3986 -9.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1180 -8.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3062 -8.1655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8241 -8.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1596 -9.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9705 -9.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5829 -12.0756 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.0114 -8.7411 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.1464 -6.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8535 -5.9421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8522 -5.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5618 -6.3497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5630 -7.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2714 -7.5744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2675 -8.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9750 -8.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6831 -8.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6792 -7.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9711 -7.1643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5584 -4.7176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5575 -3.9012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8486 -3.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1392 -3.9069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1436 -4.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2662 -5.1260 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.8463 -2.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5528 -2.2650 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.5591 -8.7991 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.3920 -8.7960 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
1 6 1 0
6 7 1 0
6 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 7 1 0
11 19 1 0
16 20 1 0
4 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
23 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 23 1 0
32 37 1 0
34 38 1 0
38 39 1 0
27 40 1 0
29 41 1 0
M CHG 1 4 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 666.28Molecular Weight (Monoisotopic): 663.0093AlogP: 10.38#Rotatable Bonds: 10Polar Surface Area: 18.04Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.11CX LogD: 7.11Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.11Np Likeness Score: -0.49
References 1. (2012) Inhibitors of eya2,