The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4'-((2-butyl-4-isopropyl-5-((5-methyl-1,3,4-oxadiazol-2-yl)methyl)-6-oxopyrimidin-1(6H)-yl)methyl)biphenyl-2-yl)-1,2,4-oxadiazol-5(4H)-one ID: ALA4458838
PubChem CID: 153392660
Max Phase: Preclinical
Molecular Formula: C30H32N6O4
Molecular Weight: 540.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1nc(C(C)C)c(Cc2nnc(C)o2)c(=O)n1Cc1ccc(-c2ccccc2-c2noc(=O)[nH]2)cc1
Standard InChI: InChI=1S/C30H32N6O4/c1-5-6-11-25-31-27(18(2)3)24(16-26-34-33-19(4)39-26)29(37)36(25)17-20-12-14-21(15-13-20)22-9-7-8-10-23(22)28-32-30(38)40-35-28/h7-10,12-15,18H,5-6,11,16-17H2,1-4H3,(H,32,35,38)
Standard InChI Key: UXTORYNVHNBEHD-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
7.2307 -19.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4382 -19.0996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9892 -19.7869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5042 -20.4264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2714 -20.1342 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2350 -14.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2308 -15.2422 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0068 -15.4987 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4905 -14.8400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0135 -14.1765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8180 -16.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8168 -17.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5249 -18.0923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2345 -17.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2317 -16.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5231 -16.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9429 -18.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9393 -18.9079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6468 -19.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3549 -18.9056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3510 -18.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6429 -17.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1102 -16.4554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1100 -15.6382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8195 -15.2312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8213 -14.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1153 -14.0053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4059 -14.4128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4024 -15.2326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5262 -15.6415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6945 -15.6408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9870 -15.2319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2791 -15.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5716 -15.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5304 -14.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3077 -14.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2906 -21.2152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1182 -13.1881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8273 -12.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4119 -12.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 6 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
11 23 1 0
23 24 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
25 30 2 0
29 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
26 35 1 0
35 6 1 0
9 36 1 0
18 1 1 0
4 37 2 0
27 38 1 0
38 39 1 0
38 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.62Molecular Weight (Monoisotopic): 540.2485AlogP: 5.05#Rotatable Bonds: 10Polar Surface Area: 132.70Molecular Species: ACIDHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 5.91CX Basic pKa: 1.84CX LogP: 4.40CX LogD: 3.55Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: -1.20
References 1. Choung W, Yang D, Kim H, Choi H, Lee BR, Park M, Jang SM, Lim JS, Kim WS, Kim KH, Chin J, Jung K, Lee G, Hong E, Jang TH, Joo J, Hwang H, Myung J, Kim SH.. (2019) Discovery of BR102375, a new class of non-TZD PPARγ full agonist for the treatment of type 2 diabetes., 29 (16): [PMID:31253533 ] [10.1016/j.bmcl.2019.06.027 ]