The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl (E)-1-(3-(but-2-enamido)benzyl)-3-(4-phenoxyphenyl)-1H-pyrazole-5-carboxylate ID: ALA4459034
PubChem CID: 155526784
Max Phase: Preclinical
Molecular Formula: C29H27N3O4
Molecular Weight: 481.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C/C(=O)Nc1cccc(Cn2nc(-c3ccc(Oc4ccccc4)cc3)cc2C(=O)OCC)c1
Standard InChI: InChI=1S/C29H27N3O4/c1-3-9-28(33)30-23-11-8-10-21(18-23)20-32-27(29(34)35-4-2)19-26(31-32)22-14-16-25(17-15-22)36-24-12-6-5-7-13-24/h3,5-19H,4,20H2,1-2H3,(H,30,33)/b9-3+
Standard InChI Key: URVFWVGOGQYUSX-YCRREMRBSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
14.4521 -16.3211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1191 -16.7933 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7755 -16.3064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5131 -15.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6968 -15.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1250 -17.6112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8370 -18.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9841 -14.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7989 -14.9388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2700 -14.2719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9274 -13.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1092 -13.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6417 -14.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3978 -12.8608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2117 -12.9340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5514 -13.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3645 -13.7527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8357 -13.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4880 -12.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6759 -12.2699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6777 -16.5820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0645 -16.0419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8444 -18.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5555 -19.2224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2576 -18.8049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2439 -17.9849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5322 -17.5903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5661 -20.0395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8638 -20.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8743 -21.2744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1508 -20.0578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1720 -21.6921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1826 -22.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5166 -17.3832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2901 -16.3029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6769 -15.7627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 1 0
6 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 8 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
1 21 1 0
21 22 1 0
7 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 7 1 0
24 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 2 0
32 33 1 0
21 34 2 0
22 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.55Molecular Weight (Monoisotopic): 481.2002AlogP: 6.08#Rotatable Bonds: 9Polar Surface Area: 82.45Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 0.71CX LogP: 6.32CX LogD: 6.32Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -1.29
References 1. Ran F, Liu Y, Zhang D, Liu M, Zhao G.. (2019) Discovery of novel pyrazole derivatives as potential anticancer agents in MCL., 29 (9): [PMID:30857748 ] [10.1016/j.bmcl.2019.03.005 ]