(9beta,13alpha,14beta,17beta,18beta,20alpha)-3-hydroxy-9,13-dimethyl-2-oxo-24,25,26-trinoroleana-1(10),3,5,7-tetraen-29-oyl-fluoride

ID: ALA4459092

PubChem CID: 138623559

Max Phase: Preclinical

Molecular Formula: C29H37FO3

Molecular Weight: 452.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1=C(O)C(=O)C=C2C1=CC=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(=O)F)CC[C@]3(C)CC[C@]12C

Standard InChI:  InChI=1S/C29H37FO3/c1-17-18-7-8-21-27(4,19(18)15-20(31)23(17)32)12-14-29(6)22-16-26(3,24(30)33)10-9-25(22,2)11-13-28(21,29)5/h7-8,15,22,32H,9-14,16H2,1-6H3/t22-,25-,26-,27+,28-,29+/m1/s1

Standard InChI Key:  COVSAPDFNJBGKH-JJWQIEBTSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   19.1950   -2.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6139   -3.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0245   -2.4866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6302   -6.0941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6291   -6.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3449   -7.3372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3431   -5.6831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0595   -6.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0603   -6.9178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7725   -7.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4885   -6.9140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7668   -5.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4808   -6.0846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4734   -4.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7600   -4.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1873   -4.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1868   -5.6751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8944   -6.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6071   -5.6760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8954   -4.4392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6096   -4.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3240   -4.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3307   -3.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8958   -3.6150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3468   -8.1627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9132   -7.3363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9146   -5.6835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1827   -4.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1786   -6.4965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0504   -5.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8880   -5.2645    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.3192   -5.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6116   -1.7724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8500   -2.4841    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  6
  4  5  1  0
  5  6  2  0
  6  9  1  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 13  2  0
 12  8  1  0
 12 13  1  0
 12 15  1  0
 13 17  1  0
 16 14  1  0
 14 15  1  0
 16 17  1  0
 16 20  1  0
 17 18  1  0
 18 19  1  0
 19 21  1  0
 20 21  1  0
 20 24  1  0
 21 22  1  0
 22 23  1  0
 23  2  1  0
  2 24  1  0
  6 25  1  0
  5 26  1  0
  4 27  2  0
 16 28  1  6
 17 29  1  1
 12 30  1  1
 20 31  1  1
 21 32  1  1
  3 33  2  0
  3 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4459092

    ---

Associated Targets(Human)

NR4A1 Tchem Nuclear receptor subfamily 4 group A member 1 (458 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 452.61Molecular Weight (Monoisotopic): 452.2727AlogP: 7.11#Rotatable Bonds: 1
Polar Surface Area: 54.37Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.75CX Basic pKa: CX LogP: 5.58CX LogD: 5.57
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: 2.99

References

1. Chen Z, Zhang D, Yan S, Hu C, Huang Z, Li Z, Peng S, Li X, Zhu Y, Yu H, Lian B, Kang Q, Li M, Zeng Z, Zhang XK, Su Y..  (2019)  SAR study of celastrol analogs targeting Nur77-mediated inflammatory pathway.,  177  [PMID:31132532] [10.1016/j.ejmech.2019.05.009]
2. Zhan, Yanyan Y and 22 more authors.  2008-09  Cytosporone B is an agonist for nuclear orphan receptor Nur77.  [PMID:18690216]

Source