The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-{[2-Ethyl-6-(4-nitrophenyl)imidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene]hydrazono}-4-methyl-2,3-dihydrothiazole-5-carboxylic acid ethyl ester ID: ALA4459134
PubChem CID: 155526898
Max Phase: Preclinical
Molecular Formula: C20H19N7O4S2
Molecular Weight: 485.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1s/c(=N\N=C\c2c(-c3ccc([N+](=O)[O-])cc3)nc3sc(CC)nn23)[nH]c1C
Standard InChI: InChI=1S/C20H19N7O4S2/c1-4-15-25-26-14(10-21-24-19-22-11(3)17(33-19)18(28)31-5-2)16(23-20(26)32-15)12-6-8-13(9-7-12)27(29)30/h6-10H,4-5H2,1-3H3,(H,22,24)/b21-10+
Standard InChI Key: WXIJEDKJMBDKCE-UFFVCSGVSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
9.3546 -6.2215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3362 -4.8803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8643 -5.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1289 -5.1253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1381 -5.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9279 -6.2023 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.4085 -5.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9130 -4.8622 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0419 -5.5702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6169 -4.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7905 -4.8687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3882 -5.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8141 -6.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6390 -6.2906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0702 -4.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2585 -3.9383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9924 -3.1553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1851 -2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8393 -2.2508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0220 -2.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8616 -3.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5799 -3.5569 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.2315 -5.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6508 -6.2258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4650 -1.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1143 -3.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4420 -3.0251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0394 -4.3195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6947 -3.3700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0224 -2.8953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5626 -5.6071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1619 -6.3260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1403 -4.9007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
3 9 1 0
2 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 18 1 0
7 23 1 0
23 24 1 0
20 25 1 0
21 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 1 0
31 32 2 0
31 33 1 0
12 31 1 0
M CHG 2 31 1 33 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.55Molecular Weight (Monoisotopic): 485.0940AlogP: 3.74#Rotatable Bonds: 7Polar Surface Area: 140.14Molecular Species: ACIDHBA: 11HBD: 1#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.46CX Basic pKa: 2.32CX LogP: 4.40CX LogD: 3.66Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.18Np Likeness Score: -2.03
References 1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R.. (2019) Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents., 174 [PMID:31051403 ] [10.1016/j.ejmech.2019.04.052 ]