The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-bromobenzylidene)-5-(4-chlorophenyl)furan-2(3H)-one ID: ALA4459168
PubChem CID: 125752267
Max Phase: Preclinical
Molecular Formula: C17H10BrClO2
Molecular Weight: 361.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1OC(c2ccc(Cl)cc2)=C/C1=C\c1ccc(Br)cc1
Standard InChI: InChI=1S/C17H10BrClO2/c18-14-5-1-11(2-6-14)9-13-10-16(21-17(13)20)12-3-7-15(19)8-4-12/h1-10H/b13-9+
Standard InChI Key: YBZPGKFVALTJGP-UKTHLTGXSA-N
Molfile:
RDKit 2D
21 23 0 0 0 0 0 0 0 0999 V2000
41.6767 -28.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4980 -28.6513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.7524 -27.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0853 -27.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4225 -27.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1914 -29.3159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.5341 -27.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6410 -27.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4708 -26.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1409 -28.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9220 -27.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0936 -27.1121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4780 -26.5636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6993 -26.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0838 -26.2645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9140 -25.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1319 -25.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5194 -25.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6923 -26.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8749 -26.8596 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
39.9606 -24.4058 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 1 0
1 6 2 0
3 7 1 0
5 8 2 0
8 9 1 0
7 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 7 1 0
9 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 9 1 0
12 20 1 0
17 21 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 361.62Molecular Weight (Monoisotopic): 359.9553AlogP: 5.08#Rotatable Bonds: 2Polar Surface Area: 26.30Molecular Species: ┄HBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.26CX LogD: 5.26Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.55Np Likeness Score: -0.37
References 1. Husain A, Khan SA, Iram F, Iqbal MA, Asif M.. (2019) Insights into the chemistry and therapeutic potential of furanones: A versatile pharmacophore., 171 [PMID:30909021 ] [10.1016/j.ejmech.2019.03.021 ]