The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 5-((((R)-1-(3,4-dichlorophenethyl)pyrrolidin-3-yl)methyl)carbamoyl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate ID: ALA4459378
PubChem CID: 153635955
Max Phase: Preclinical
Molecular Formula: C29H32Cl2N4O5
Molecular Weight: 587.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=C(C)NC(C)=C(C(=O)NC[C@H]2CCN(CCc3ccc(Cl)c(Cl)c3)C2)C1c1cccc([N+](=O)[O-])c1
Standard InChI: InChI=1S/C29H32Cl2N4O5/c1-17-25(27(26(18(2)33-17)29(37)40-3)21-5-4-6-22(14-21)35(38)39)28(36)32-15-20-10-12-34(16-20)11-9-19-7-8-23(30)24(31)13-19/h4-8,13-14,20,27,33H,9-12,15-16H2,1-3H3,(H,32,36)/t20-,27?/m1/s1
Standard InChI Key: OZNXNCRWVNCHCW-ACVCQEAVSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
4.8030 -27.1447 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6023 -26.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6892 -26.1618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9404 -25.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3965 -26.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3974 -25.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1047 -26.1632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8128 -25.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5201 -26.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8136 -24.9381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5152 -26.9814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2216 -27.3906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9307 -26.9826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9289 -26.1612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2219 -25.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2192 -24.9394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9271 -24.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9247 -23.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2150 -23.3056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5064 -23.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5123 -24.5360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6335 -23.3015 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6311 -22.4843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3424 -23.7080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8059 -27.3873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6386 -27.3910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6356 -25.7508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3443 -26.1576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0510 -25.7472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6335 -24.9336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4699 -27.8909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6571 -27.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3241 -28.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5105 -28.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1774 -29.5496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6573 -30.2121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4741 -30.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8034 -29.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3253 -30.9588 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.3646 -29.6339 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
3 6 1 6
6 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 9 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
15 16 1 0
22 23 2 0
22 24 1 0
18 22 1 0
11 25 1 0
13 26 1 0
14 27 1 0
27 28 1 0
28 29 1 0
27 30 2 0
1 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
36 39 1 0
35 40 1 0
M CHG 2 22 1 24 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 587.50Molecular Weight (Monoisotopic): 586.1750AlogP: 4.99#Rotatable Bonds: 9Polar Surface Area: 113.81Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.39CX LogP: 4.16CX LogD: 3.13Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.24Np Likeness Score: -1.33
References 1. Son WS, Jeong KS, Lim SM, Pae AN.. (2019) Structural hybridization of pyrrolidine-based T-type calcium channel inhibitors and exploration of their analgesic effects in a neuropathic pain model., 29 (10): [PMID:30928197 ] [10.1016/j.bmcl.2019.03.026 ]