The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Polystachyol ID: ALA4459465
PubChem CID: 92016157
Max Phase: Preclinical
Molecular Formula: C22H28O8
Molecular Weight: 420.46
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc([C@H]2c3c(cc(OC)c(O)c3OC)C[C@H](CO)[C@H]2CO)cc(OC)c1O
Standard InChI: InChI=1S/C22H28O8/c1-27-15-7-12(8-16(28-2)20(15)25)18-14(10-24)13(9-23)5-11-6-17(29-3)21(26)22(30-4)19(11)18/h6-8,13-14,18,23-26H,5,9-10H2,1-4H3/t13-,14-,18-/m1/s1
Standard InChI Key: ZDVZKBOFCHOPLM-HBUWYVDXSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
30.2324 -10.1671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2313 -10.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9460 -11.4073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9442 -9.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6596 -10.1634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6584 -10.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3714 -11.4049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0901 -10.9939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0912 -10.1655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3737 -9.7479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3676 -12.2267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6504 -12.6366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6477 -13.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3616 -13.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0796 -13.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0787 -12.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3604 -14.7011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7943 -13.8732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7949 -14.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9320 -13.8710 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9293 -14.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9477 -12.2323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2341 -12.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5164 -11.4063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5178 -9.7547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5176 -8.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8066 -9.7547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5201 -10.1689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8033 -11.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5190 -10.9979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
7 6 1 0
7 8 1 0
8 9 1 0
9 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
7 11 1 1
14 17 1 0
15 18 1 0
18 19 1 0
13 20 1 0
20 21 1 0
3 22 1 0
22 23 1 0
2 24 1 0
1 25 1 0
25 26 1 0
9 27 1 6
27 28 1 0
8 29 1 1
29 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.46Molecular Weight (Monoisotopic): 420.1784AlogP: 2.04#Rotatable Bonds: 7Polar Surface Area: 117.84Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.24CX Basic pKa: ┄CX LogP: 1.47CX LogD: 1.46Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.54Np Likeness Score: 1.69
References 1. Thao NP, Luyen BT, Vinh le B, Lee JY, Kwon YI, Kim YH.. (2016) Rat intestinal sucrase inhibited by minor constituents from the leaves and twigs of Archidendron clypearia (Jack.) Nielsen., 26 (17): [PMID:27481560 ] [10.1016/j.bmcl.2016.07.044 ]