The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-((R)-1-(2,4-dichlorophenyl)ethyl)-6-((4S,5R)-5-methyl-4-((S)-2-(trifluoromethyl)pyrrolidin-1-yl)cyclohex-1-enyl)-1H-pyrazolo[4,3-b]pyrazine-3-carbonitrile ID: ALA4459504
PubChem CID: 155527411
Max Phase: Preclinical
Molecular Formula: C26H25Cl2F3N6
Molecular Weight: 549.43
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1CC(c2cnc3c(C#N)nn([C@H](C)c4ccc(Cl)cc4Cl)c3n2)=CC[C@@H]1N1CCC[C@H]1C(F)(F)F
Standard InChI: InChI=1S/C26H25Cl2F3N6/c1-14-10-16(5-8-22(14)36-9-3-4-23(36)26(29,30)31)21-13-33-24-20(12-32)35-37(25(24)34-21)15(2)18-7-6-17(27)11-19(18)28/h5-7,11,13-15,22-23H,3-4,8-10H2,1-2H3/t14-,15-,22+,23+/m1/s1
Standard InChI Key: WXPQSLFDLMSAIY-OIQQBYHCSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
4.1236 -15.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8337 -16.4062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5508 -15.9982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5562 -15.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8383 -14.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1192 -15.1626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2730 -14.7577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9897 -15.1799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7099 -14.7676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2759 -13.9321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9932 -13.5216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7126 -13.9354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3286 -13.3791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9897 -12.6213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1645 -12.7096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6115 -12.0974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8652 -11.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8048 -12.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2540 -11.6547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4480 -11.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1937 -12.6127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7515 -13.2263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5554 -13.0508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3873 -12.7867 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.5096 -10.8703 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.4100 -16.4005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8279 -17.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6588 -16.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1074 -16.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5192 -17.3932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3250 -17.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4867 -15.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1327 -13.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9399 -13.7189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0994 -14.7083 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.7020 -15.0063 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.2665 -14.4576 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
4 7 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 11 1 0
15 16 1 0
16 17 1 1
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
19 25 1 0
1 26 1 1
2 27 1 1
26 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 26 1 0
28 32 1 1
33 34 3 0
13 33 1 0
32 35 1 0
32 36 1 0
32 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 549.43Molecular Weight (Monoisotopic): 548.1470AlogP: 6.82#Rotatable Bonds: 4Polar Surface Area: 70.63Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.48CX LogP: 6.67CX LogD: 6.67Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: -0.84
References 1. Jackson JJ, Ketcham JM, Younai A, Abraham B, Biannic B, Beck HP, Bui MHT, Chian D, Cutler G, Diokno R, Hu DX, Jacobson S, Karbarz E, Kassner PD, Marshall L, McKinnell J, Meleza C, Okal A, Pookot D, Reilly MK, Robles O, Shunatona HP, Talay O, Walker JR, Wadsworth A, Wustrow DJ, Zibinsky M.. (2019) Discovery of a Potent and Selective CCR4 Antagonist That Inhibits Treg Trafficking into the Tumor Microenvironment., 62 (13): [PMID:31259550 ] [10.1021/acs.jmedchem.9b00506 ]