N-(benzo[d][1,3]dioxol-5-ylmethyl)-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine

ID: ALA4459594

Cas Number: 1030123-90-0

PubChem CID: 9196193

Product Number: A412954, Order Now?

Max Phase: Preclinical

Molecular Formula: C20H14FN3O2S

Molecular Weight: 379.42

Molecule Type: Unknown

Associated Items:

This product is currently unavailable

Names and Identifiers

Canonical SMILES:  Fc1ccc(-c2csc3ncnc(NCc4ccc5c(c4)OCO5)c23)cc1

Standard InChI:  InChI=1S/C20H14FN3O2S/c21-14-4-2-13(3-5-14)15-9-27-20-18(15)19(23-10-24-20)22-8-12-1-6-16-17(7-12)26-11-25-16/h1-7,9-10H,8,11H2,(H,22,23,24)

Standard InChI Key:  QGYLTGSHWIGJJD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 31  0  0  0  0  0  0  0  0999 V2000
    5.4435   -7.3945    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1532   -6.9851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1504   -6.1624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4418   -5.7572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4393   -4.9400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7355   -6.9856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7322   -6.1691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9546   -5.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4773   -6.5824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9600   -7.2410    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.6990   -5.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2461   -4.5368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9910   -3.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1903   -3.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6450   -4.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9030   -4.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9336   -2.8180    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.1458   -4.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1434   -3.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8517   -3.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4313   -2.4972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4369   -3.3123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1401   -2.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8453   -2.4913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4523   -1.9471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1224   -1.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3114   -1.2851    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  6  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  7  1  0
  4  5  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  1  0
  8 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
  5 18  1  0
 18 19  1  0
 19 20  2  0
 20 24  1  0
 23 21  1  0
 21 22  2  0
 22 19  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4459594

    AEM1

Associated Targets(non-human)

Nfe2l2 Nuclear factor erythroid 2-related factor 2 (714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 379.42Molecular Weight (Monoisotopic): 379.0791AlogP: 4.84#Rotatable Bonds: 4
Polar Surface Area: 56.27Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.92CX LogP: 4.50CX LogD: 4.50
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.55Np Likeness Score: -1.52

References

1. Jiang ZY, Lu MC, You QD..  (2019)  Nuclear Factor Erythroid 2-Related Factor 2 (Nrf2) Inhibition: An Emerging Strategy in Cancer Therapy.,  62  (8): [PMID:30444366] [10.1021/acs.jmedchem.8b01121]

Source