(5-(Bis(4-chlorophenyl)methyl)-3-methylthiophene-2-carbonyl)-L-arginine

ID: ALA4459627

PubChem CID: 145996525

Product Number: J611283, Order Now?

Max Phase: Preclinical

Molecular Formula: C25H26Cl2N4O3S

Molecular Weight: 533.48

Molecule Type: Unknown

In stock!

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)sc1C(=O)N[C@@H](CCCNC(=N)N)C(=O)O

Standard InChI:  InChI=1S/C25H26Cl2N4O3S/c1-14-13-20(21(15-4-8-17(26)9-5-15)16-6-10-18(27)11-7-16)35-22(14)23(32)31-19(24(33)34)3-2-12-30-25(28)29/h4-11,13,19,21H,2-3,12H2,1H3,(H,31,32)(H,33,34)(H4,28,29,30)/t19-/m0/s1

Standard InChI Key:  OHRIKWUZKGNQKQ-IBGZPJMESA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   30.4162  -25.2697    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   31.1583  -24.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0545  -24.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2446  -23.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8526  -24.6757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8797  -25.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8991  -26.1315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5816  -24.8851    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3029  -25.2767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0048  -24.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3224  -26.0978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6205  -26.5273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.0438  -26.4936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.9854  -24.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6832  -23.6008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6637  -22.7798    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3656  -22.3544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3462  -21.5333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.0870  -22.7461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0309  -24.6726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6250  -23.9592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6197  -25.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7982  -25.3776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3870  -26.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7966  -26.7993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6216  -26.7977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0291  -26.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0448  -23.2534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6396  -22.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8179  -22.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4032  -23.2481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8108  -23.9581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6486  -23.5429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4128  -21.8251    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   27.3880  -27.5071    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  2  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  1  1
  9 11  1  0
 11 12  1  0
 11 13  2  0
 10 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
  5 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 21 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 21  1  0
  3 33  1  0
 30 34  1  0
 25 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4459627

    JR14a

Associated Targets(Human)

C3AR1 Tchem C3a anaphylatoxin chemotactic receptor (750 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
C5AR1 Tclin C5a anaphylatoxin chemotactic receptor (2677 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 533.48Molecular Weight (Monoisotopic): 532.1103AlogP: 4.99#Rotatable Bonds: 10
Polar Surface Area: 128.30Molecular Species: ZWITTERIONHBA: 4HBD: 5
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.64CX Basic pKa: 11.97CX LogP: 3.82CX LogD: 3.82
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.14Np Likeness Score: -0.40

References

1. Rowley JA, Reid RC, Poon EKY, Wu KC, Lim J, Lohman RJ, Hamidon JK, Yau MK, Halili MA, Durek T, Iyer A, Fairlie DP..  (2020)  Potent Thiophene Antagonists of Human Complement C3a Receptor with Anti-Inflammatory Activity.,  63  (2): [PMID:31910011] [10.1021/acs.jmedchem.9b00927]

Source