The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-amino-3-hydroxy-N-(2-methoxy-5-(6,7,8-trimethoxy-4,5-dihydro-2H-benzo[e]indazol-1-yl)phenyl)propanamide hydrochloride ID: ALA4459718
PubChem CID: 155527269
Max Phase: Preclinical
Molecular Formula: C24H29ClN4O6
Molecular Weight: 468.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2[nH]nc3c2-c2cc(OC)c(OC)c(OC)c2CC3)cc1NC(=O)[C@@H](N)CO.Cl
Standard InChI: InChI=1S/C24H28N4O6.ClH/c1-31-18-8-5-12(9-17(18)26-24(30)15(25)11-29)21-20-14-10-19(32-2)23(34-4)22(33-3)13(14)6-7-16(20)27-28-21;/h5,8-10,15,29H,6-7,11,25H2,1-4H3,(H,26,30)(H,27,28);1H/t15-;/m0./s1
Standard InChI Key: BOPFKFUXSUCUAX-RSAXXLAASA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
33.4223 -26.7238 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
27.4075 -23.1331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4064 -23.9567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1144 -24.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8282 -23.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1126 -22.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8245 -23.1300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8179 -21.4930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1063 -21.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6956 -22.7205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6954 -21.8992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6942 -24.3648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9827 -23.9556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1142 -25.1870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4064 -25.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5297 -21.8988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5319 -22.7139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3080 -22.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7872 -22.3051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3046 -21.6462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5635 -23.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0165 -24.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2705 -25.1322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0752 -25.3007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6254 -24.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3644 -23.9094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3308 -26.0810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.7864 -26.6945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4257 -24.8523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9689 -24.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7693 -24.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3125 -23.7965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7119 -23.4661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0263 -25.1827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1128 -23.9617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 7 1 0
6 2 1 0
6 7 2 0
6 9 1 0
7 17 1 0
16 8 1 0
8 9 1 0
2 10 1 0
10 11 1 0
3 12 1 0
12 13 1 0
4 14 1 0
14 15 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 16 2 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
18 21 1 0
24 27 1 0
27 28 1 0
25 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
30 33 2 0
31 34 1 6
32 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.51Molecular Weight (Monoisotopic): 468.2009AlogP: 2.13#Rotatable Bonds: 8Polar Surface Area: 140.95Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.75CX Basic pKa: 7.69CX LogP: 1.13CX LogD: 0.67Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: 0.11
References 1. Jiang J, Zhang H, Wang C, Zhang Q, Fang S, Zhou R, Hu J, Zhu J, Zhou Y, Luo C, Zheng C.. (2019) 1-Phenyl-dihydrobenzoindazoles as novel colchicine site inhibitors: Structural basis and antitumor efficacy., 177 [PMID:31174062 ] [10.1016/j.ejmech.2019.04.040 ]