The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-((4-(3-(hydroxyamino)-3-oxoprop-1-en-1-yl)benzyl)oxy)quinoline-2-carboxamide ID: ALA4459795
PubChem CID: 155527385
Max Phase: Preclinical
Molecular Formula: C20H17N3O4
Molecular Weight: 363.37
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccc(CONC(=O)c2ccc3ccccc3n2)cc1)NO
Standard InChI: InChI=1S/C20H17N3O4/c24-19(22-26)12-9-14-5-7-15(8-6-14)13-27-23-20(25)18-11-10-16-3-1-2-4-17(16)21-18/h1-12,26H,13H2,(H,22,24)(H,23,25)/b12-9+
Standard InChI Key: SCYAVNQVZVEEPH-FMIVXFBMSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
35.7032 -6.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7021 -7.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4143 -7.9063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1239 -7.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1211 -6.6660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4125 -6.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9899 -7.9054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2784 -7.4921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8314 -6.2547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5448 -6.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2551 -6.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9684 -6.6553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2520 -5.4281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6787 -6.2440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5663 -7.9043 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8548 -7.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1426 -7.9032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8554 -6.6697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4345 -7.4890 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4383 -9.1317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1470 -8.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7259 -8.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7293 -7.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0220 -7.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3107 -7.8998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3112 -8.7223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0192 -9.1275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
5 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
8 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
19 23 1 0
22 20 1 0
20 21 2 0
21 17 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 22 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 363.37Molecular Weight (Monoisotopic): 363.1219AlogP: 2.62#Rotatable Bonds: 6Polar Surface Area: 100.55Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.55CX Basic pKa: 1.09CX LogP: 2.82CX LogD: 2.82Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.36Np Likeness Score: -0.64
References 1. Pflieger M, Hamacher A, Öz T, Horstick-Muche N, Boesen B, Schrenk C, Kassack MU, Kurz T.. (2019) Novel α,β-unsaturated hydroxamic acid derivatives overcome cisplatin resistance., 27 (19): [PMID:31431326 ] [10.1016/j.bmc.2019.07.052 ]