The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,6-Difluorophenyl)-N-[N'-[2-(4-fluorophenyl)acetyl]hydrazinocarbothioyl]acetamide ID: ALA4459829
PubChem CID: 89717861
Max Phase: Preclinical
Molecular Formula: C17H14F3N3O2S
Molecular Weight: 381.38
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccc(F)cc1)NNC(=S)NC(=O)Cc1c(F)cccc1F
Standard InChI: InChI=1S/C17H14F3N3O2S/c18-11-6-4-10(5-7-11)8-16(25)22-23-17(26)21-15(24)9-12-13(19)2-1-3-14(12)20/h1-7H,8-9H2,(H,22,25)(H2,21,23,24,26)
Standard InChI Key: LEPWLFRSQIPIJN-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
40.1662 -2.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8739 -2.0512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5816 -2.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2893 -2.0512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.9970 -2.4598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.7047 -2.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4124 -2.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4585 -2.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1662 -3.2770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.7047 -1.2340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.5816 -3.2770 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.7508 -2.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0436 -2.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3364 -2.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3360 -3.2741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0486 -3.6825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7530 -3.2723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1201 -2.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8268 -2.4639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5340 -2.0559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5344 -1.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8217 -0.8294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1174 -1.2397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0453 -1.2309 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
39.4620 -3.6785 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
47.2416 -0.8283 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
1 8 1 0
1 9 2 0
6 10 2 0
3 11 2 0
8 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
7 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
13 24 1 0
17 25 1 0
21 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 381.38Molecular Weight (Monoisotopic): 381.0759AlogP: 1.91#Rotatable Bonds: 4Polar Surface Area: 70.23Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.49CX Basic pKa: ┄CX LogP: 3.02CX LogD: 3.02Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.56Np Likeness Score: -1.96
References 1. (2014) Serine racemase inhibitor,