The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-(4-(but-2-enamido)benzyl)-3-(4-phenoxyphenyl)-1H-pyrazole-5-carboxylic acid ID: ALA4460329
PubChem CID: 155527886
Max Phase: Preclinical
Molecular Formula: C27H23N3O4
Molecular Weight: 453.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C/C(=O)Nc1ccc(Cn2nc(-c3ccc(Oc4ccccc4)cc3)cc2C(=O)O)cc1
Standard InChI: InChI=1S/C27H23N3O4/c1-2-6-26(31)28-21-13-9-19(10-14-21)18-30-25(27(32)33)17-24(29-30)20-11-15-23(16-12-20)34-22-7-4-3-5-8-22/h2-17H,18H2,1H3,(H,28,31)(H,32,33)/b6-2+
Standard InChI Key: LKSLXWLURPYICP-QHHAFSJGSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
25.7401 -5.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4070 -6.4711 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0635 -5.9842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8010 -5.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9848 -5.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4130 -7.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1250 -7.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2721 -4.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0869 -4.6166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5580 -3.9497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2154 -3.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3971 -3.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9297 -3.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6857 -2.5386 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4996 -2.6118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8394 -3.3570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6525 -3.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1237 -2.7617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7760 -2.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9639 -1.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9657 -6.2598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3525 -5.7197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1323 -8.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8435 -8.9002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5455 -8.4827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5319 -7.6627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8202 -7.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2592 -8.8808 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2712 -9.6979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9849 -10.0960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5696 -10.1169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9970 -10.9131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7106 -11.3112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8045 -7.0610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 1 0
6 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 8 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
1 21 1 0
21 22 1 0
7 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 7 1 0
25 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 2 0
32 33 1 0
21 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.50Molecular Weight (Monoisotopic): 453.1689AlogP: 5.60#Rotatable Bonds: 8Polar Surface Area: 93.45Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.25CX Basic pKa: 0.72CX LogP: 5.62CX LogD: 2.18Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -1.12
References 1. Ran F, Liu Y, Zhang D, Liu M, Zhao G.. (2019) Discovery of novel pyrazole derivatives as potential anticancer agents in MCL., 29 (9): [PMID:30857748 ] [10.1016/j.bmcl.2019.03.005 ]