The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1S)-1,5-anhydro-1-(5-{[4-{(1E)-4-[(1-hydroxy-2-methylpropan-2-yl)amino]-3,3-dimethyl-4-oxobut-1-en-1-yl}-2-(propan-2-yl)phenyl]methyl}-2,4-dimethylphenyl)-D-glucitol ID: ALA4460379
PubChem CID: 155527667
Max Phase: Preclinical
Molecular Formula: C34H49NO7
Molecular Weight: 583.77
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)c([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc(/C=C/C(C)(C)C(=O)NC(C)(C)CO)cc1C(C)C
Standard InChI: InChI=1S/C34H49NO7/c1-19(2)25-14-22(11-12-33(5,6)32(41)35-34(7,8)18-37)9-10-23(25)15-24-16-26(21(4)13-20(24)3)31-30(40)29(39)28(38)27(17-36)42-31/h9-14,16,19,27-31,36-40H,15,17-18H2,1-8H3,(H,35,41)/b12-11+/t27-,28-,29+,30-,31+/m1/s1
Standard InChI Key: XCLMQLPTGZPJTO-JMDDWNQGSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
31.9114 -2.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5032 -2.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0903 -2.8515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9407 -1.0166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3574 -1.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7697 -1.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9354 -2.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9341 -2.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6490 -3.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3653 -2.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3625 -2.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6472 -1.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2229 -3.3952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5090 -2.9799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7964 -3.3884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7914 -4.2136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5055 -4.6290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2242 -4.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0752 -4.6229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9380 -4.6326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5019 -5.4538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0839 -2.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0876 -2.1477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0805 -3.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7943 -2.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5060 -3.3946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2194 -2.9817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2185 -2.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4984 -1.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7880 -2.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9317 -1.7413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6473 -2.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0762 -2.1476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7895 -1.7330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.0786 -2.9725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2184 -1.7289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9341 -2.1393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2208 -1.7459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0754 -1.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5061 -4.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7917 -4.6322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2206 -4.6320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
13 8 1 1
16 19 1 6
18 20 1 6
17 21 1 1
15 22 1 1
22 23 1 0
10 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 2 0
32 5 1 0
5 33 1 0
33 34 1 0
33 35 2 0
34 2 1 0
2 36 1 0
36 37 1 0
7 38 1 0
11 39 1 0
26 40 1 0
40 41 1 0
40 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.77Molecular Weight (Monoisotopic): 583.3509AlogP: 3.46#Rotatable Bonds: 10Polar Surface Area: 139.48Molecular Species: NEUTRALHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.57CX Basic pKa: ┄CX LogP: 4.35CX LogD: 4.35Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.25Np Likeness Score: 0.83
References 1. Kuroda S, Kobashi Y, Oi T, Kawabe K, Shiozawa F, Okumura-Kitajima L, Sugisaki-Kitano M, Io F, Yamamoto K, Kakinuma H.. (2019) Discovery of potent, low-absorbable sodium-dependent glucose cotransporter 1 (SGLT1) inhibitor SGL5213 for type 2 diabetes treatment., 27 (2): [PMID:30579799 ] [10.1016/j.bmc.2018.12.015 ]