(2R,3S,4R,5R,6R)-5-amino-2-((cinnamylamino)methyl)-6-((1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyloxy)tetrahydro-2H-pyran-3,4-diol

ID: ALA4460433

PubChem CID: 155527954

Max Phase: Preclinical

Molecular Formula: C21H34N4O6

Molecular Weight: 438.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N)C[C@@H]2N)O[C@H](CNC/C=C/c2ccccc2)[C@@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C21H34N4O6/c22-12-9-13(23)20(19(29)16(12)26)31-21-15(24)18(28)17(27)14(30-21)10-25-8-4-7-11-5-2-1-3-6-11/h1-7,12-21,25-29H,8-10,22-24H2/b7-4+/t12-,13+,14-,15-,16+,17-,18-,19-,20-,21-/m1/s1

Standard InChI Key:  CAKMUVKRDJODMZ-MYYOWIPTSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   17.6476  -11.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6200  -10.9224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8973  -10.5378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2019  -10.9700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2296  -11.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9525  -12.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9801  -13.0004    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3128  -10.4849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4773  -10.5804    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3698  -12.1255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5307  -12.2212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8066  -11.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7865  -11.0126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0665  -10.6219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3651  -11.0529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3884  -11.8748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1131  -12.2658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1383  -13.0867    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6424  -10.6595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0443   -9.8009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8413  -12.6552    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.6880  -12.3027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7448   -9.3732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7227   -8.5522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4232   -8.1205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4010   -7.2995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1015   -6.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8232   -7.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5191   -6.8382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4974   -6.0163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7698   -5.6232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0769   -6.0565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  1
  2  8  1  1
  4  9  1  1
  1 10  1  6
  5 11  1  6
 11 12  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  6
 15 19  1  6
 14 20  1  1
 12 21  1  1
 16 22  1  1
 20 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4460433

    ---

Associated Targets(non-human)

rev Protein Rev (94 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 438.53Molecular Weight (Monoisotopic): 438.2478AlogP: -2.77#Rotatable Bonds: 7
Polar Surface Area: 189.47Molecular Species: BASEHBA: 10HBD: 8
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 11#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.66CX Basic pKa: 9.15CX LogP: -2.52CX LogD: -6.36
Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.21Np Likeness Score: 1.22

References

1. Simon B, Walmsley C, Jackson VJ, Garvey EP, Slater MJ, Berrisford DJ, Gardiner JM..  (2019)  Evaluation of neomycin analogues for HIV-1 RRE RNA recognition identifies enhanced activity simplified neamine analogues.,  29  (2): [PMID:30477891] [10.1016/j.bmcl.2018.11.004]

Source