Tatanan A

ID: ALA4460577

PubChem CID: 53231603

Max Phase: Preclinical

Molecular Formula: C36H48O9

Molecular Weight: 624.77

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC[C@@H](c1cc(OC)c(OC)cc1OC)[C@H](C)[C@@H](/C(C)=C/c1cc(OC)c(OC)cc1OC)c1cc(OC)c(OC)cc1OC

Standard InChI:  InChI=1S/C36H48O9/c1-13-24(25-16-31(41-8)34(44-11)19-28(25)38-5)22(3)36(26-17-32(42-9)35(45-12)20-29(26)39-6)21(2)14-23-15-30(40-7)33(43-10)18-27(23)37-4/h14-20,22,24,36H,13H2,1-12H3/b21-14+/t22-,24+,36+/m0/s1

Standard InChI Key:  YHSWIYJJKPHZLA-KALZQYQPSA-N

Molfile:  

 
     RDKit          2D

 45 47  0  0  0  0  0  0  0  0999 V2000
   31.3793  -12.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0912  -12.5138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6716  -12.5138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6716  -11.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9598  -11.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3793  -11.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9598  -10.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0912  -11.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6740  -10.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6744   -9.2313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9620   -8.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2478   -9.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2510  -10.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8030  -12.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9598  -12.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2485  -12.5106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5372  -12.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5367  -13.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2535  -14.1533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9620  -13.7431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8005  -13.7489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5115  -14.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2243  -13.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2216  -12.9232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5101  -12.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3793  -13.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5405  -10.4691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.8273  -10.0587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9609   -8.0006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6722   -7.5869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3823   -8.8230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.0939   -9.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2502  -11.6893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5392  -11.2793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8254  -14.1544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.1130  -13.7468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2564  -14.9746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5460  -15.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5111  -14.9787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.7990  -15.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9367  -14.1564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9377  -14.9777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5075  -11.6929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2181  -11.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8030  -11.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  5  7  1  0
  2  8  1  0
  7  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  7  1  0
  2 14  1  1
  3 15  1  6
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 14 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 14  1  0
  1 26  1  6
 13 27  1  0
 27 28  1  0
 11 29  1  0
 29 30  1  0
 10 31  1  0
 31 32  1  0
 16 33  1  0
 33 34  1  0
 18 35  1  0
 35 36  1  0
 19 37  1  0
 37 38  1  0
 22 39  1  0
 39 40  1  0
 23 41  1  0
 41 42  1  0
 25 43  1  0
 43 44  1  0
  8 45  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4460577

    Tatanan A

Associated Targets(non-human)

Dengue virus (413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 624.77Molecular Weight (Monoisotopic): 624.3298AlogP: 7.78#Rotatable Bonds: 16
Polar Surface Area: 83.07Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.83CX LogD: 6.83
Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.16Np Likeness Score: 0.21

References

1. Dighe SN, Ekwudu O, Dua K, Chellappan DK, Katavic PL, Collet TA..  (2019)  Recent update on anti-dengue drug discovery.,  176  [PMID:31128447] [10.1016/j.ejmech.2019.05.010]

Source