5-Methyl-1-(4-nitrobenzyl)-4-(n-octylamino)pyrimidin-2(1H)-one

ID: ALA4460648

PubChem CID: 149278385

Max Phase: Preclinical

Molecular Formula: C20H28N4O3

Molecular Weight: 372.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCNc1nc(=O)n(Cc2ccc([N+](=O)[O-])cc2)cc1C

Standard InChI:  InChI=1S/C20H28N4O3/c1-3-4-5-6-7-8-13-21-19-16(2)14-23(20(25)22-19)15-17-9-11-18(12-10-17)24(26)27/h9-12,14H,3-8,13,15H2,1-2H3,(H,21,22,25)

Standard InChI Key:  XSLWLUSAZUSEMO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
   14.4769  -12.5302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4758  -13.3498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1838  -13.7587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8935  -13.3493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8906  -12.5266    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1820  -12.1214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7691  -12.1218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6018  -13.7568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1836  -14.5759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1796  -11.3042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8912  -14.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8869  -15.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5937  -16.2088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3024  -15.8003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3000  -14.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5927  -14.5739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8861  -10.8935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5950  -11.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3015  -10.8892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0104  -11.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7169  -10.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4258  -11.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1323  -10.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8412  -11.2873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0142  -16.2067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7215  -15.7973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0151  -17.0239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  4  8  2  0
  3  9  1  0
  6 10  1  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 25 26  2  0
 25 27  1  0
 14 25  1  0
M  CHG  2  25   1  27  -1
M  END

Alternative Forms

  1. Parent:

    ALA4460648

    ---

Associated Targets(non-human)

Tlr4 Toll-like receptor 4 (76 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 372.47Molecular Weight (Monoisotopic): 372.2161AlogP: 4.28#Rotatable Bonds: 11
Polar Surface Area: 90.06Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.43CX LogD: 4.43
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.36Np Likeness Score: -1.03

References

1. Trifonov L, Nudelman V, Zhenin M, Matsree E, Afri M, Schmerling B, Cohen G, Jozwiak K, Weitman M, Korshin E, Senderowitz H, Shainberg A, Hochhauser E, Gruzman A..  (2018)  Structurally Simple, Readily Available Peptidomimetic 1-Benzyl-5-methyl-4-( n-octylamino)pyrimidin-2(1 H)-one Exhibited Efficient Cardioprotection in a Myocardial Ischemia (MI) Mouse Model.,  61  (24): [PMID:30507195] [10.1021/acs.jmedchem.8b01471]

Source