The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-Acrylamidobenzyl)-3-(4-phenoxyphenyl)-1H-pyrazole-5-carboxylic acid ID: ALA4460820
PubChem CID: 141741217
Max Phase: Preclinical
Molecular Formula: C26H21N3O4
Molecular Weight: 439.47
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1ccc(Cn2nc(-c3ccc(Oc4ccccc4)cc3)cc2C(=O)O)cc1
Standard InChI: InChI=1S/C26H21N3O4/c1-2-25(30)27-20-12-8-18(9-13-20)17-29-24(26(31)32)16-23(28-29)19-10-14-22(15-11-19)33-21-6-4-3-5-7-21/h2-16H,1,17H2,(H,27,30)(H,31,32)
Standard InChI Key: AUEIDBMFYZDVQR-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
15.9173 -6.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5842 -7.1480 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2407 -6.6611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9782 -5.8845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1620 -5.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5902 -7.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3022 -8.3643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4493 -5.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2641 -5.2934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7352 -4.6266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3926 -3.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5743 -3.8117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1069 -4.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8629 -3.2154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6768 -3.2886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0166 -4.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8297 -4.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3009 -3.4386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9531 -2.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1411 -2.6246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1429 -6.9367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5297 -6.3966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3095 -9.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0207 -9.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7227 -9.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7091 -8.3396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9974 -7.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4364 -9.5577 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4484 -10.3748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1621 -10.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7468 -10.7938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1742 -11.5900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9817 -7.7378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 7 1 0
6 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
4 8 1 0
11 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
1 21 1 0
21 22 1 0
7 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 7 1 0
25 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 2 0
21 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.47Molecular Weight (Monoisotopic): 439.1532AlogP: 5.21#Rotatable Bonds: 8Polar Surface Area: 93.45Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.25CX Basic pKa: 0.72CX LogP: 5.23CX LogD: 1.79Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -1.14
References 1. Ran F, Liu Y, Zhang D, Liu M, Zhao G.. (2019) Discovery of novel pyrazole derivatives as potential anticancer agents in MCL., 29 (9): [PMID:30857748 ] [10.1016/j.bmcl.2019.03.005 ]