The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4S)-4-Acetamido-5-(((2S)-1-(2-(((S)-1-amino-3-mercapto-1-oxopropan-2-yl)carbamoyl)pyrrolidin-1-yl)-4-(methylthio)-1-oxobutan-2-yl)amino)-5-oxopentanoic Acid ID: ALA4460867
PubChem CID: 155528112
Max Phase: Preclinical
Molecular Formula: C20H33N5O7S2
Molecular Weight: 519.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CSCC[C@H](NC(=O)[C@H](CCC(=O)O)NC(C)=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CS)C(N)=O
Standard InChI: InChI=1S/C20H33N5O7S2/c1-11(26)22-12(5-6-16(27)28)18(30)23-13(7-9-34-2)20(32)25-8-3-4-15(25)19(31)24-14(10-33)17(21)29/h12-15,33H,3-10H2,1-2H3,(H2,21,29)(H,22,26)(H,23,30)(H,24,31)(H,27,28)/t12-,13-,14-,15-/m0/s1
Standard InChI Key: RJVKPOLLIYWBEM-AJNGGQMLSA-N
Molfile:
RDKit 2D
34 34 0 0 0 0 0 0 0 0999 V2000
25.6102 -14.8672 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.9008 -14.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1913 -13.2328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.9008 -13.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1913 -14.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1913 -15.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9008 -16.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9008 -16.9102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6102 -15.6844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6102 -13.2328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6102 -12.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0248 -12.4156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3154 -12.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9008 -12.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9008 -11.1899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1913 -10.7813 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.1913 -9.9641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3154 -11.1899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9782 -10.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9266 -11.7576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7551 -10.9609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7233 -9.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6552 -10.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9067 -9.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3341 -10.3819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.1218 -10.5948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7558 -11.9615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3347 -11.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7008 -10.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4885 -10.2247 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.1225 -11.5955 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3154 -14.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0248 -14.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3154 -13.6414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4 10 1 0
13 18 1 0
21 25 1 0
28 31 1 0
1 2 1 0
2 4 1 0
4 3 2 0
2 5 1 1
5 6 1 0
6 7 1 0
7 8 2 0
7 9 1 0
11 10 1 1
11 13 1 0
13 12 2 0
11 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
18 19 1 0
19 21 1 1
21 20 2 0
19 22 1 0
23 24 1 0
24 22 1 0
23 18 1 0
26 25 1 1
26 28 1 0
28 27 2 0
26 29 1 0
29 30 1 0
1 32 1 0
32 33 1 0
32 34 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.65Molecular Weight (Monoisotopic): 519.1821AlogP: -1.52#Rotatable Bonds: 14Polar Surface Area: 188.00Molecular Species: ACIDHBA: 8HBD: 6#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 4.03CX Basic pKa: ┄CX LogP: -2.56CX LogD: -5.70Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.15Np Likeness Score: -0.35
References 1. Trifonov L, Nudelman V, Zhenin M, Matsree E, Afri M, Schmerling B, Cohen G, Jozwiak K, Weitman M, Korshin E, Senderowitz H, Shainberg A, Hochhauser E, Gruzman A.. (2018) Structurally Simple, Readily Available Peptidomimetic 1-Benzyl-5-methyl-4-( n-octylamino)pyrimidin-2(1 H)-one Exhibited Efficient Cardioprotection in a Myocardial Ischemia (MI) Mouse Model., 61 (24): [PMID:30507195 ] [10.1021/acs.jmedchem.8b01471 ]