(4S)-4-Acetamido-5-(((2S)-1-(2-(((S)-1-amino-3-mercapto-1-oxopropan-2-yl)carbamoyl)pyrrolidin-1-yl)-4-(methylthio)-1-oxobutan-2-yl)amino)-5-oxopentanoic Acid

ID: ALA4460867

PubChem CID: 155528112

Max Phase: Preclinical

Molecular Formula: C20H33N5O7S2

Molecular Weight: 519.65

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CSCC[C@H](NC(=O)[C@H](CCC(=O)O)NC(C)=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CS)C(N)=O

Standard InChI:  InChI=1S/C20H33N5O7S2/c1-11(26)22-12(5-6-16(27)28)18(30)23-13(7-9-34-2)20(32)25-8-3-4-15(25)19(31)24-14(10-33)17(21)29/h12-15,33H,3-10H2,1-2H3,(H2,21,29)(H,22,26)(H,23,30)(H,24,31)(H,27,28)/t12-,13-,14-,15-/m0/s1

Standard InChI Key:  RJVKPOLLIYWBEM-AJNGGQMLSA-N

Molfile:  

 
     RDKit          2D

 34 34  0  0  0  0  0  0  0  0999 V2000
   25.6102  -14.8672    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.9008  -14.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1913  -13.2328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9008  -13.6414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1913  -14.8672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1913  -15.6844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9008  -16.0930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9008  -16.9102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6102  -15.6844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6102  -13.2328    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.6102  -12.4156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0248  -12.4156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3154  -12.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9008  -12.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9008  -11.1899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1913  -10.7813    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.1913   -9.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3154  -11.1899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.9782  -10.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9266  -11.7576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7551  -10.9609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7233   -9.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6552  -10.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9067   -9.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3341  -10.3819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.1218  -10.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7558  -11.9615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.3347  -11.3826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7008  -10.0159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4885  -10.2247    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.1225  -11.5955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3154  -14.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0248  -14.8672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3154  -13.6414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4 10  1  0
 13 18  1  0
 21 25  1  0
 28 31  1  0
  1  2  1  0
  2  4  1  0
  4  3  2  0
  2  5  1  1
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
 11 10  1  1
 11 13  1  0
 13 12  2  0
 11 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 18 19  1  0
 19 21  1  1
 21 20  2  0
 19 22  1  0
 23 24  1  0
 24 22  1  0
 23 18  1  0
 26 25  1  1
 26 28  1  0
 28 27  2  0
 26 29  1  0
 29 30  1  0
  1 32  1  0
 32 33  1  0
 32 34  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4460867

    ---

Associated Targets(non-human)

Tlr4 Toll-like receptor 4 (76 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 519.65Molecular Weight (Monoisotopic): 519.1821AlogP: -1.52#Rotatable Bonds: 14
Polar Surface Area: 188.00Molecular Species: ACIDHBA: 8HBD: 6
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 6#RO5 Violations (Lipinski): 3
CX Acidic pKa: 4.03CX Basic pKa: CX LogP: -2.56CX LogD: -5.70
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.15Np Likeness Score: -0.35

References

1. Trifonov L, Nudelman V, Zhenin M, Matsree E, Afri M, Schmerling B, Cohen G, Jozwiak K, Weitman M, Korshin E, Senderowitz H, Shainberg A, Hochhauser E, Gruzman A..  (2018)  Structurally Simple, Readily Available Peptidomimetic 1-Benzyl-5-methyl-4-( n-octylamino)pyrimidin-2(1 H)-one Exhibited Efficient Cardioprotection in a Myocardial Ischemia (MI) Mouse Model.,  61  (24): [PMID:30507195] [10.1021/acs.jmedchem.8b01471]

Source