The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Alangilignoside C ID: ALA4461067
PubChem CID: 155528232
Max Phase: Preclinical
Molecular Formula: C28H38O13
Molecular Weight: 582.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C[C@H]2CO[C@H](c3cc(OC)c(O)c(OC)c3)[C@H]2CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(OC)c1O
Standard InChI: InChI=1S/C28H38O13/c1-35-17-6-13(7-18(36-2)22(17)30)5-15-11-39-27(14-8-19(37-3)23(31)20(9-14)38-4)16(15)12-40-28-26(34)25(33)24(32)21(10-29)41-28/h6-9,15-16,21,24-34H,5,10-12H2,1-4H3/t15-,16-,21+,24+,25-,26+,27+,28+/m0/s1
Standard InChI Key: HIFLTWHGASFARX-CIBVIZDISA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
30.6818 -4.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5031 -4.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7616 -3.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0945 -2.8519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4316 -3.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6502 -3.0819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4832 -2.2797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7026 -2.0274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0905 -2.5789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2642 -3.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0446 -3.6344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3087 -2.3236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5327 -1.2240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1400 -0.6731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6591 -3.9351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8322 -4.7379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9868 -4.7807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8037 -4.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2006 -4.7795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5320 -5.5306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0467 -6.1952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2792 -5.3619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0954 -5.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4335 -4.5270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9452 -3.8593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1307 -3.9467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2504 -4.4414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.2800 -3.1078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0966 -3.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5788 -5.9439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.3958 -5.8598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2296 -6.1062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7489 -6.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0766 -7.5199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8941 -7.6085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3838 -6.9439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2005 -7.0309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2270 -8.3607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5929 -8.1786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.9325 -6.6773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4447 -7.3359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
5 6 1 1
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
9 12 1 0
8 13 1 0
13 14 1 0
10 15 1 0
15 16 1 0
2 17 1 6
17 18 1 0
1 19 1 6
19 20 1 0
21 20 1 1
18 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 18 1 0
24 27 1 0
25 28 1 0
28 29 1 0
23 30 1 0
30 31 1 0
21 32 1 0
21 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 6
35 38 1 1
34 39 1 6
33 40 1 1
40 41 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 582.60Molecular Weight (Monoisotopic): 582.2312AlogP: 0.50#Rotatable Bonds: 11Polar Surface Area: 185.99Molecular Species: NEUTRALHBA: 13HBD: 6#RO5 Violations: 3HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.15CX Basic pKa: ┄CX LogP: 0.22CX LogD: 0.21Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.22Np Likeness Score: 1.68
References 1. Thao NP, Luyen BT, Vinh le B, Lee JY, Kwon YI, Kim YH.. (2016) Rat intestinal sucrase inhibited by minor constituents from the leaves and twigs of Archidendron clypearia (Jack.) Nielsen., 26 (17): [PMID:27481560 ] [10.1016/j.bmcl.2016.07.044 ]