The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-methoxyphenyl)-1-(4-methoxyphenyl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2(9H)-carboxamide ID: ALA4461090
PubChem CID: 50759035
Max Phase: Preclinical
Molecular Formula: C26H25N3O3
Molecular Weight: 427.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C2c3[nH]c4ccccc4c3CCN2C(=O)Nc2ccccc2OC)cc1
Standard InChI: InChI=1S/C26H25N3O3/c1-31-18-13-11-17(12-14-18)25-24-20(19-7-3-4-8-21(19)27-24)15-16-29(25)26(30)28-22-9-5-6-10-23(22)32-2/h3-14,25,27H,15-16H2,1-2H3,(H,28,30)
Standard InChI Key: OIOQNNZXASNPDE-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
42.0245 -14.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7257 -14.2611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.7139 -13.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0009 -13.0455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0360 -15.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3321 -15.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3424 -16.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0559 -17.1258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7605 -16.7035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7467 -15.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3161 -14.2815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3014 -13.4693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5482 -14.5464 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.0588 -13.8981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5245 -13.2351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1830 -12.5024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3761 -12.4315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9119 -13.0993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2560 -13.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4387 -14.6604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4494 -15.4776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.1410 -14.2426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.8540 -14.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8626 -15.4575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.5748 -15.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.2781 -15.4389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.2647 -14.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.5520 -14.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.5377 -13.4049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.2382 -12.9840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0677 -17.9429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.3660 -18.3616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 4 1 0
11 1 1 0
1 2 1 0
2 3 1 0
3 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
1 5 1 0
11 12 2 0
12 15 1 0
14 13 1 0
13 11 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
2 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
28 29 1 0
29 30 1 0
8 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.50Molecular Weight (Monoisotopic): 427.1896AlogP: 5.36#Rotatable Bonds: 4Polar Surface Area: 66.59Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.82CX Basic pKa: ┄CX LogP: 4.58CX LogD: 4.58Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -0.85
References 1. Tikhmyanova N, Paparoidamis N, Romero-Masters J, Feng X, Mohammed FS, Reddy PAN, Kenney SC, Lieberman PM, Salvino JM.. (2019) Development of a novel inducer for EBV lytic therapy., 29 (16): [PMID:31255485 ] [10.1016/j.bmcl.2019.06.034 ]