Rac-3-(3-Chlorophenyl)-3-((6-(2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethoxy)pyridazin-3-yl)amino)propanoic Acid

ID: ALA4461155

PubChem CID: 155528189

Max Phase: Preclinical

Molecular Formula: C23H24ClN5O3

Molecular Weight: 453.93

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CC(Nc1ccc(OCCc2ccc3c(n2)NCCC3)nn1)c1cccc(Cl)c1

Standard InChI:  InChI=1S/C23H24ClN5O3/c24-17-5-1-3-16(13-17)19(14-22(30)31)27-20-8-9-21(29-28-20)32-12-10-18-7-6-15-4-2-11-25-23(15)26-18/h1,3,5-9,13,19H,2,4,10-12,14H2,(H,25,26)(H,27,28)(H,30,31)

Standard InChI Key:  YSHCUQUSNSOANU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    4.5120  -19.1810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2285  -18.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2255  -17.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5102  -17.5280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7973  -18.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7969  -17.9408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0841  -17.5297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3671  -17.9415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3675  -18.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0849  -19.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9384  -17.5221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6545  -17.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3673  -17.5166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0834  -17.9264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0833  -18.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7985  -19.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5123  -18.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5066  -17.9155    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7908  -17.5096    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2289  -19.1535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9412  -18.7374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6577  -19.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3700  -18.7302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0866  -19.1390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3658  -17.9052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9369  -17.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6510  -17.4986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6470  -16.6744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9300  -16.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2153  -16.6853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2227  -17.5081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3596  -16.2587    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  3 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 21 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 28 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4461155

    ---

Associated Targets(Human)

ITGAV Tchem Integrin alpha-V/beta-6 (509 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ITGB3 Tclin Integrin alpha-V/beta-3 (2708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 453.93Molecular Weight (Monoisotopic): 453.1568AlogP: 4.13#Rotatable Bonds: 9
Polar Surface Area: 109.26Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.69CX Basic pKa: 7.18CX LogP: 1.59CX LogD: 1.19
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.94

References

1. Anderson NA, Campos S, Butler S, Copley RCB, Duncan I, Harrison S, Le J, Maghames R, Pastor-Garcia A, Pritchard JM, Rowedder JE, Smith CE, Thomas J, Vitulli G, Macdonald SJF..  (2019)  Discovery of an Orally Bioavailable Pan αv Integrin Inhibitor for Idiopathic Pulmonary Fibrosis.,  62  (19): [PMID:31497959] [10.1021/acs.jmedchem.9b00962]

Source