(Z)-2-((5-(2-methyl-5-nitrophenyl)furan-2-yl)methylene)benzo[d]thiazolo[3,2-a]imidazol-3(2H)-one

ID: ALA4461414

PubChem CID: 1041878

Max Phase: Preclinical

Molecular Formula: C21H13N3O4S

Molecular Weight: 403.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc([N+](=O)[O-])cc1-c1ccc(/C=c2\sc3nc4ccccc4n3c2=O)o1

Standard InChI:  InChI=1S/C21H13N3O4S/c1-12-6-7-13(24(26)27)10-15(12)18-9-8-14(28-18)11-19-20(25)23-17-5-3-2-4-16(17)22-21(23)29-19/h2-11H,1H3/b19-11-

Standard InChI Key:  JSWDFTRDLPNICR-ODLFYWEKSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   21.6572  -12.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1244  -13.1645    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.1429  -11.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9165  -12.1057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.9027  -12.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6753  -13.1881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.6976  -11.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1677  -12.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9836  -12.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3306  -11.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8555  -11.0511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0412  -11.1258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8999  -11.0622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8401  -12.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4214  -13.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6078  -13.2642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4264  -14.0610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1282  -14.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7432  -13.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6783  -14.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0241  -13.8925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2734  -14.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1758  -15.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8349  -15.5159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5830  -15.1923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6160  -13.7245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8646  -14.0457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7136  -12.9131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2384  -15.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  5  1  0
  4  3  1  0
  3  1  1  0
  4  5  1  0
  5  6  2  0
  6  8  1  0
  7  4  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3 13  2  0
  1 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  2  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 20  1  0
 26 27  2  0
 26 28  1  0
 22 26  1  0
 25 29  1  0
M  CHG  2  26   1  28  -1
M  END

Associated Targets(Human)

PTPN5 Tchem Tyrosine-protein phosphatase non-receptor type 5 (536 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 403.42Molecular Weight (Monoisotopic): 403.0627AlogP: 3.93#Rotatable Bonds: 3
Polar Surface Area: 90.65Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.76CX LogD: 4.76
Aromatic Rings: 5Heavy Atoms: 29QED Weighted: 0.34Np Likeness Score: -1.93

References

1. Ge L, Li KS, Li MM, Xiao P, Hou XB, Chen X, Liu HD, Lin A, Yu X, Ren GJ, Fang H, Sun JP..  (2016)  Identification of a benzo imidazole thiazole derivative as the specific irreversible inhibitor of protein tyrosine phosphatase.,  26  (19): [PMID:27554446] [10.1016/j.bmcl.2016.08.024]

Source