The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 7-((1-(4-fluorobenzyl)-1H-1,2,3-triazol-4-yl)methoxy)-2-oxo-2H-chromene-3-carboxylate ID: ALA4461573
PubChem CID: 155528552
Max Phase: Preclinical
Molecular Formula: C22H18FN3O5
Molecular Weight: 423.40
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1cc2ccc(OCc3cn(Cc4ccc(F)cc4)nn3)cc2oc1=O
Standard InChI: InChI=1S/C22H18FN3O5/c1-2-29-21(27)19-9-15-5-8-18(10-20(15)31-22(19)28)30-13-17-12-26(25-24-17)11-14-3-6-16(23)7-4-14/h3-10,12H,2,11,13H2,1H3
Standard InChI Key: XGRNHKJKKPZMBT-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
25.1049 -1.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0990 -2.9052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3864 -2.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3915 -1.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8192 -1.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8149 -2.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5247 -2.9037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2394 -2.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2398 -1.6683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5294 -1.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6779 -1.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6798 -0.4303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.9625 -1.6662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2489 -1.2520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5335 -1.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6695 -2.8970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.9530 -2.9092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6684 -2.4983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3819 -2.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4705 -3.7306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2771 -3.9041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.6914 -3.1905 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.1406 -2.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5134 -3.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9284 -3.9006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5136 -4.6144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9279 -5.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7538 -5.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1636 -4.6036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7469 -3.8940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1698 -6.0370 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 4 2 0
1 5 1 0
3 2 1 0
2 6 1 0
3 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
4 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
3 16 2 0
8 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 19 2 0
22 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.40Molecular Weight (Monoisotopic): 423.1230AlogP: 3.33#Rotatable Bonds: 7Polar Surface Area: 96.45Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.67CX LogD: 3.67Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.33Np Likeness Score: -1.46
References 1. Thanh ND, Hai DS, Ngoc Bich VT, Thu Hien PT, Ky Duyen NT, Mai NT, Dung TT, Toan VN, Kim Van HT, Dang LH, Toan DN, Thanh Van TT.. (2019) Efficient click chemistry towards novel 1H-1,2,3-triazole-tethered 4H-chromene-d-glucose conjugates: Design, synthesis and evaluation of in vitro antibacterial, MRSA and antifungal activities., 167 [PMID:30784879 ] [10.1016/j.ejmech.2019.01.060 ]