Ethyl 7-((1-(4-fluorobenzyl)-1H-1,2,3-triazol-4-yl)methoxy)-2-oxo-2H-chromene-3-carboxylate

ID: ALA4461573

PubChem CID: 155528552

Max Phase: Preclinical

Molecular Formula: C22H18FN3O5

Molecular Weight: 423.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1cc2ccc(OCc3cn(Cc4ccc(F)cc4)nn3)cc2oc1=O

Standard InChI:  InChI=1S/C22H18FN3O5/c1-2-29-21(27)19-9-15-5-8-18(10-20(15)31-22(19)28)30-13-17-12-26(25-24-17)11-14-3-6-16(23)7-4-14/h3-10,12H,2,11,13H2,1H3

Standard InChI Key:  XGRNHKJKKPZMBT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   25.1049   -1.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0990   -2.9052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.3864   -2.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3915   -1.6696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8192   -1.6664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8149   -2.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5247   -2.9037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2394   -2.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2398   -1.6683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5294   -1.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6779   -1.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6798   -0.4303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.9625   -1.6662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2489   -1.2520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5335   -1.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6695   -2.8970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9530   -2.9092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6684   -2.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3819   -2.9126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4705   -3.7306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2771   -3.9041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6914   -3.1905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1406   -2.5762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5134   -3.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9284   -3.9006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5136   -4.6144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9279   -5.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7538   -5.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1636   -4.6036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7469   -3.8940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1698   -6.0370    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  1  5  1  0
  3  2  1  0
  2  6  1  0
  3  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  4 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
  3 16  2  0
  8 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 19  2  0
 22 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4461573

    ---

Associated Targets(non-human)

Aspergillus niger (16508 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Candida albicans (78123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.40Molecular Weight (Monoisotopic): 423.1230AlogP: 3.33#Rotatable Bonds: 7
Polar Surface Area: 96.45Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.67CX LogD: 3.67
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.33Np Likeness Score: -1.46

References

1. Thanh ND, Hai DS, Ngoc Bich VT, Thu Hien PT, Ky Duyen NT, Mai NT, Dung TT, Toan VN, Kim Van HT, Dang LH, Toan DN, Thanh Van TT..  (2019)  Efficient click chemistry towards novel 1H-1,2,3-triazole-tethered 4H-chromene-d-glucose conjugates: Design, synthesis and evaluation of in vitro antibacterial, MRSA and antifungal activities.,  167  [PMID:30784879] [10.1016/j.ejmech.2019.01.060]

Source