N-(5-cyclopropyl-2-(3,5-dimethyl-4H-1,2,4-triazol-4-yl)benzyl)acetamide

ID: ALA4461772

PubChem CID: 155528756

Max Phase: Preclinical

Molecular Formula: C16H20N4O

Molecular Weight: 284.36

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)NCc1cc(C2CC2)ccc1-n1c(C)nnc1C

Standard InChI:  InChI=1S/C16H20N4O/c1-10-18-19-11(2)20(10)16-7-6-14(13-4-5-13)8-15(16)9-17-12(3)21/h6-8,13H,4-5,9H2,1-3H3,(H,17,21)

Standard InChI Key:  QPXSJNGYRFNNBG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   37.7627   -4.0199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7616   -4.8394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4696   -5.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1793   -4.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1765   -4.0163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4678   -3.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4654   -2.7938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.1219   -2.3143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8671   -1.5378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0498   -1.5403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.7997   -2.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8998   -2.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0240   -2.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8826   -3.6050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5919   -4.0110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.2980   -3.5997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0073   -4.0056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2949   -2.7825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.4694   -6.0656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0652   -6.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8824   -6.7714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
  8 12  1  0
 11 13  1  0
  5 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
  3 19  1  0
 20 19  1  0
 21 20  1  0
 19 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4461772

    ---

Associated Targets(Human)

SETDB1 Tbio Histone-lysine N-methyltransferase SETDB1 (88 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 284.36Molecular Weight (Monoisotopic): 284.1637AlogP: 2.40#Rotatable Bonds: 4
Polar Surface Area: 59.81Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.86CX LogP: 0.75CX LogD: 0.75
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.94Np Likeness Score: -0.93

References

1. Mader P, Mendoza-Sanchez R, Iqbal A, Dong A, Dobrovetsky E, Corless VB, Liew SK, Houliston SR, De Freitas RF, Smil D, Sena CCD, Kennedy S, Diaz DB, Wu H, Dombrovski L, Allali-Hassani A, Min J, Schapira M, Vedadi M, Brown PJ, Santhakumar V, Yudin AK, Arrowsmith CH..  (2019)  Identification and characterization of the first fragment hits for SETDB1 Tudor domain.,  27  (17): [PMID:31327677] [10.1016/j.bmc.2019.07.020]

Source