The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(3-((R)-2-carboxy-2-(4-iodobenzamido)ethyl)ureido)pentanedioic Acid ID: ALA4461865
PubChem CID: 152021787
Max Phase: Preclinical
Molecular Formula: C16H18IN3O8
Molecular Weight: 507.24
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CC[C@H](NC(=O)NC[C@@H](NC(=O)c1ccc(I)cc1)C(=O)O)C(=O)O
Standard InChI: InChI=1S/C16H18IN3O8/c17-9-3-1-8(2-4-9)13(23)19-11(15(26)27)7-18-16(28)20-10(14(24)25)5-6-12(21)22/h1-4,10-11H,5-7H2,(H,19,23)(H,21,22)(H,24,25)(H,26,27)(H2,18,20,28)/t10-,11+/m0/s1
Standard InChI Key: UKWMEQZENRUSPF-WDEREUQCSA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
32.3779 -14.5732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0856 -14.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7933 -14.5732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5010 -14.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2087 -14.5732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9164 -14.1646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2087 -15.3904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0856 -13.3475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.5010 -13.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2087 -12.9389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2087 -12.1217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9164 -11.7131 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.5010 -11.7131 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6702 -14.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9625 -14.5732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2548 -14.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2548 -13.3475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5471 -14.5732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9625 -15.3904 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2548 -15.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2548 -16.6162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5471 -15.3904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5437 -17.0211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5433 -17.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2516 -18.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9616 -17.8339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9585 -17.0189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2526 -19.0641 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 2 0
2 8 2 0
4 9 1 1
9 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
1 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
15 19 1 1
19 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
25 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.24Molecular Weight (Monoisotopic): 507.0139AlogP: 0.09#Rotatable Bonds: 10Polar Surface Area: 182.13Molecular Species: ACIDHBA: 5HBD: 6#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 2.73CX Basic pKa: ┄CX LogP: 0.27CX LogD: -9.72Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.24Np Likeness Score: -0.65
References 1. Kim K, Kwon H, Barinka C, Motlova L, Nam S, Choi D, Ha H, Nam H, Son SH, Minn I, Pomper MG, Yang X, Kutil Z, Byun Y.. (2020) Novel β- and γ-Amino Acid-Derived Inhibitors of Prostate-Specific Membrane Antigen., 63 (6): [PMID:32097010 ] [10.1021/acs.jmedchem.9b02022 ]