N-(2-(5-methoxy-1H-indol-3-yl)ethyl)-6,6,7,7-tetramethyl-5,6,7,8-tetrahydronaphthalene-2-carboxamide

ID: ALA4461877

PubChem CID: 155528918

Max Phase: Preclinical

Molecular Formula: C26H32N2O2

Molecular Weight: 404.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2[nH]cc(CCNC(=O)c3ccc4c(c3)CC(C)(C)C(C)(C)C4)c2c1

Standard InChI:  InChI=1S/C26H32N2O2/c1-25(2)14-18-7-6-17(12-20(18)15-26(25,3)4)24(29)27-11-10-19-16-28-23-9-8-21(30-5)13-22(19)23/h6-9,12-13,16,28H,10-11,14-15H2,1-5H3,(H,27,29)

Standard InChI Key:  MWIRKMROTUEKOB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   17.7264  -21.0365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9093  -21.0365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3179  -21.7442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3096  -19.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9051  -20.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7221  -20.2146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7842  -22.5676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7831  -23.3872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4911  -23.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4894  -22.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1980  -22.5640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2028  -23.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9828  -23.6311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4602  -22.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9750  -22.3066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9690  -21.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6736  -21.0725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6676  -20.2553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3722  -19.8415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3662  -19.0243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0829  -20.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0764  -22.1592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0762  -21.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0854  -21.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7953  -21.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7818  -19.8307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4922  -20.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4974  -21.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2048  -21.4510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1944  -19.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
  7 22  1  0
 22 23  1  0
 21 24  2  0
 24 25  1  0
 25 28  2  0
 27 26  2  0
 26 21  1  0
 27 28  1  0
 27 30  1  0
 28 29  1  0
 29  2  1  0
  2  5  1  0
  5 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4461877

    ---

Associated Targets(non-human)

Liver (4264 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 404.55Molecular Weight (Monoisotopic): 404.2464AlogP: 5.30#Rotatable Bonds: 5
Polar Surface Area: 54.12Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.63CX LogD: 5.63
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.61Np Likeness Score: -0.30

References

1. Wang SY, Shi XC, Laborda P..  (2020)  Indole-based melatonin analogues: Synthetic approaches and biological activity.,  185  [PMID:31727472] [10.1016/j.ejmech.2019.111847]

Source